mirror of https://github.com/postgres/postgres
This commit introduces a new SQL function pg_sync_replication_slots() which is used to synchronize the logical replication slots from the primary server to the physical standby so that logical replication can be resumed after a failover or planned switchover. A new 'synced' flag is introduced in pg_replication_slots view, indicating whether the slot has been synchronized from the primary server. On a standby, synced slots cannot be dropped or consumed, and any attempt to perform logical decoding on them will result in an error. The logical replication slots on the primary can be synchronized to the hot standby by using the 'failover' parameter of pg-create-logical-replication-slot(), or by using the 'failover' option of CREATE SUBSCRIPTION during slot creation, and then calling pg_sync_replication_slots() on standby. For the synchronization to work, it is mandatory to have a physical replication slot between the primary and the standby aka 'primary_slot_name' should be configured on the standby, and 'hot_standby_feedback' must be enabled on the standby. It is also necessary to specify a valid 'dbname' in the 'primary_conninfo'. If a logical slot is invalidated on the primary, then that slot on the standby is also invalidated. If a logical slot on the primary is valid but is invalidated on the standby, then that slot is dropped but will be recreated on the standby in the next pg_sync_replication_slots() call provided the slot still exists on the primary server. It is okay to recreate such slots as long as these are not consumable on standby (which is the case currently). This situation may occur due to the following reasons: - The 'max_slot_wal_keep_size' on the standby is insufficient to retain WAL records from the restart_lsn of the slot. - 'primary_slot_name' is temporarily reset to null and the physical slot is removed. The slot synchronization status on the standby can be monitored using the 'synced' column of pg_replication_slots view. A functionality to automatically synchronize slots by a background worker and allow logical walsenders to wait for the physical will be done in subsequent commits. Author: Hou Zhijie, Shveta Malik, Ajin Cherian based on an earlier version by Peter Eisentraut Reviewed-by: Masahiko Sawada, Bertrand Drouvot, Peter Smith, Dilip Kumar, Nisha Moond, Kuroda Hayato, Amit Kapila Discussion: https://postgr.es/m/514f6f2f-6833-4539-39f1-96cd1e011f23@enterprisedb.compull/157/head
parent
06bd311bce
commit
ddd5f4f54a
@ -0,0 +1,906 @@ |
||||
/*-------------------------------------------------------------------------
|
||||
* slotsync.c |
||||
* Functionality for synchronizing slots to a standby server from the |
||||
* primary server. |
||||
* |
||||
* Copyright (c) 2024, PostgreSQL Global Development Group |
||||
* |
||||
* IDENTIFICATION |
||||
* src/backend/replication/logical/slotsync.c |
||||
* |
||||
* This file contains the code for slot synchronization on a physical standby |
||||
* to fetch logical failover slots information from the primary server, create |
||||
* the slots on the standby and synchronize them. This is done by a call to SQL |
||||
* function pg_sync_replication_slots. |
||||
* |
||||
* If on physical standby, the WAL corresponding to the remote's restart_lsn |
||||
* is not available or the remote's catalog_xmin precedes the oldest xid for which |
||||
* it is guaranteed that rows wouldn't have been removed then we cannot create |
||||
* the local standby slot because that would mean moving the local slot |
||||
* backward and decoding won't be possible via such a slot. In this case, the |
||||
* slot will be marked as RS_TEMPORARY. Once the primary server catches up, |
||||
* the slot will be marked as RS_PERSISTENT (which means sync-ready) after |
||||
* which we can call pg_sync_replication_slots() periodically to perform |
||||
* syncs. |
||||
* |
||||
* Any standby synchronized slots will be dropped if they no longer need |
||||
* to be synchronized. See comment atop drop_local_obsolete_slots() for more |
||||
* details. |
||||
*--------------------------------------------------------------------------- |
||||
*/ |
||||
|
||||
#include "postgres.h" |
||||
|
||||
#include "access/xlog_internal.h" |
||||
#include "access/xlogrecovery.h" |
||||
#include "catalog/pg_database.h" |
||||
#include "commands/dbcommands.h" |
||||
#include "replication/logical.h" |
||||
#include "replication/slotsync.h" |
||||
#include "storage/ipc.h" |
||||
#include "storage/lmgr.h" |
||||
#include "storage/procarray.h" |
||||
#include "utils/builtins.h" |
||||
#include "utils/pg_lsn.h" |
||||
|
||||
/* Struct for sharing information to control slot synchronization. */ |
||||
typedef struct SlotSyncCtxStruct |
||||
{ |
||||
/* prevents concurrent slot syncs to avoid slot overwrites */ |
||||
bool syncing; |
||||
slock_t mutex; |
||||
} SlotSyncCtxStruct; |
||||
|
||||
SlotSyncCtxStruct *SlotSyncCtx = NULL; |
||||
|
||||
/*
|
||||
* Flag to tell if we are syncing replication slots. Unlike the 'syncing' flag |
||||
* in SlotSyncCtxStruct, this flag is true only if the current process is |
||||
* performing slot synchronization. |
||||
*/ |
||||
static bool syncing_slots = false; |
||||
|
||||
/*
|
||||
* Structure to hold information fetched from the primary server about a logical |
||||
* replication slot. |
||||
*/ |
||||
typedef struct RemoteSlot |
||||
{ |
||||
char *name; |
||||
char *plugin; |
||||
char *database; |
||||
bool two_phase; |
||||
bool failover; |
||||
XLogRecPtr restart_lsn; |
||||
XLogRecPtr confirmed_lsn; |
||||
TransactionId catalog_xmin; |
||||
|
||||
/* RS_INVAL_NONE if valid, or the reason of invalidation */ |
||||
ReplicationSlotInvalidationCause invalidated; |
||||
} RemoteSlot; |
||||
|
||||
/*
|
||||
* If necessary, update the local synced slot's metadata based on the data |
||||
* from the remote slot. |
||||
* |
||||
* If no update was needed (the data of the remote slot is the same as the |
||||
* local slot) return false, otherwise true. |
||||
*/ |
||||
static bool |
||||
update_local_synced_slot(RemoteSlot *remote_slot, Oid remote_dbid) |
||||
{ |
||||
ReplicationSlot *slot = MyReplicationSlot; |
||||
bool xmin_changed; |
||||
bool restart_lsn_changed; |
||||
NameData plugin_name; |
||||
|
||||
Assert(slot->data.invalidated == RS_INVAL_NONE); |
||||
|
||||
xmin_changed = (remote_slot->catalog_xmin != slot->data.catalog_xmin); |
||||
restart_lsn_changed = (remote_slot->restart_lsn != slot->data.restart_lsn); |
||||
|
||||
if (!xmin_changed && |
||||
!restart_lsn_changed && |
||||
remote_dbid == slot->data.database && |
||||
remote_slot->two_phase == slot->data.two_phase && |
||||
remote_slot->failover == slot->data.failover && |
||||
remote_slot->confirmed_lsn == slot->data.confirmed_flush && |
||||
strcmp(remote_slot->plugin, NameStr(slot->data.plugin)) == 0) |
||||
return false; |
||||
|
||||
/* Avoid expensive operations while holding a spinlock. */ |
||||
namestrcpy(&plugin_name, remote_slot->plugin); |
||||
|
||||
SpinLockAcquire(&slot->mutex); |
||||
slot->data.plugin = plugin_name; |
||||
slot->data.database = remote_dbid; |
||||
slot->data.two_phase = remote_slot->two_phase; |
||||
slot->data.failover = remote_slot->failover; |
||||
slot->data.restart_lsn = remote_slot->restart_lsn; |
||||
slot->data.confirmed_flush = remote_slot->confirmed_lsn; |
||||
slot->data.catalog_xmin = remote_slot->catalog_xmin; |
||||
slot->effective_catalog_xmin = remote_slot->catalog_xmin; |
||||
SpinLockRelease(&slot->mutex); |
||||
|
||||
if (xmin_changed) |
||||
ReplicationSlotsComputeRequiredXmin(false); |
||||
|
||||
if (restart_lsn_changed) |
||||
ReplicationSlotsComputeRequiredLSN(); |
||||
|
||||
return true; |
||||
} |
||||
|
||||
/*
|
||||
* Get the list of local logical slots that are synchronized from the |
||||
* primary server. |
||||
*/ |
||||
static List * |
||||
get_local_synced_slots(void) |
||||
{ |
||||
List *local_slots = NIL; |
||||
|
||||
LWLockAcquire(ReplicationSlotControlLock, LW_SHARED); |
||||
|
||||
for (int i = 0; i < max_replication_slots; i++) |
||||
{ |
||||
ReplicationSlot *s = &ReplicationSlotCtl->replication_slots[i]; |
||||
|
||||
/* Check if it is a synchronized slot */ |
||||
if (s->in_use && s->data.synced) |
||||
{ |
||||
Assert(SlotIsLogical(s)); |
||||
local_slots = lappend(local_slots, s); |
||||
} |
||||
} |
||||
|
||||
LWLockRelease(ReplicationSlotControlLock); |
||||
|
||||
return local_slots; |
||||
} |
||||
|
||||
/*
|
||||
* Helper function to check if local_slot is required to be retained. |
||||
* |
||||
* Return false either if local_slot does not exist in the remote_slots list |
||||
* or is invalidated while the corresponding remote slot is still valid, |
||||
* otherwise true. |
||||
*/ |
||||
static bool |
||||
local_sync_slot_required(ReplicationSlot *local_slot, List *remote_slots) |
||||
{ |
||||
bool remote_exists = false; |
||||
bool locally_invalidated = false; |
||||
|
||||
foreach_ptr(RemoteSlot, remote_slot, remote_slots) |
||||
{ |
||||
if (strcmp(remote_slot->name, NameStr(local_slot->data.name)) == 0) |
||||
{ |
||||
remote_exists = true; |
||||
|
||||
/*
|
||||
* If remote slot is not invalidated but local slot is marked as |
||||
* invalidated, then set locally_invalidated flag. |
||||
*/ |
||||
SpinLockAcquire(&local_slot->mutex); |
||||
locally_invalidated = |
||||
(remote_slot->invalidated == RS_INVAL_NONE) && |
||||
(local_slot->data.invalidated != RS_INVAL_NONE); |
||||
SpinLockRelease(&local_slot->mutex); |
||||
|
||||
break; |
||||
} |
||||
} |
||||
|
||||
return (remote_exists && !locally_invalidated); |
||||
} |
||||
|
||||
/*
|
||||
* Drop local obsolete slots. |
||||
* |
||||
* Drop the local slots that no longer need to be synced i.e. these either do |
||||
* not exist on the primary or are no longer enabled for failover. |
||||
* |
||||
* Additionally, drop any slots that are valid on the primary but got |
||||
* invalidated on the standby. This situation may occur due to the following |
||||
* reasons: |
||||
* - The 'max_slot_wal_keep_size' on the standby is insufficient to retain WAL |
||||
* records from the restart_lsn of the slot. |
||||
* - 'primary_slot_name' is temporarily reset to null and the physical slot is |
||||
* removed. |
||||
* These dropped slots will get recreated in next sync-cycle and it is okay to |
||||
* drop and recreate such slots as long as these are not consumable on the |
||||
* standby (which is the case currently). |
||||
* |
||||
* Note: Change of 'wal_level' on the primary server to a level lower than |
||||
* logical may also result in slot invalidation and removal on the standby. |
||||
* This is because such 'wal_level' change is only possible if the logical |
||||
* slots are removed on the primary server, so it's expected to see the |
||||
* slots being invalidated and removed on the standby too (and re-created |
||||
* if they are re-created on the primary server). |
||||
*/ |
||||
static void |
||||
drop_local_obsolete_slots(List *remote_slot_list) |
||||
{ |
||||
List *local_slots = get_local_synced_slots(); |
||||
|
||||
foreach_ptr(ReplicationSlot, local_slot, local_slots) |
||||
{ |
||||
/* Drop the local slot if it is not required to be retained. */ |
||||
if (!local_sync_slot_required(local_slot, remote_slot_list)) |
||||
{ |
||||
bool synced_slot; |
||||
|
||||
/*
|
||||
* Use shared lock to prevent a conflict with |
||||
* ReplicationSlotsDropDBSlots(), trying to drop the same slot |
||||
* during a drop-database operation. |
||||
*/ |
||||
LockSharedObject(DatabaseRelationId, local_slot->data.database, |
||||
0, AccessShareLock); |
||||
|
||||
/*
|
||||
* In the small window between getting the slot to drop and |
||||
* locking the database, there is a possibility of a parallel |
||||
* database drop by the startup process and the creation of a new |
||||
* slot by the user. This new user-created slot may end up using |
||||
* the same shared memory as that of 'local_slot'. Thus check if |
||||
* local_slot is still the synced one before performing actual |
||||
* drop. |
||||
*/ |
||||
SpinLockAcquire(&local_slot->mutex); |
||||
synced_slot = local_slot->in_use && local_slot->data.synced; |
||||
SpinLockRelease(&local_slot->mutex); |
||||
|
||||
if (synced_slot) |
||||
{ |
||||
ReplicationSlotAcquire(NameStr(local_slot->data.name), true); |
||||
ReplicationSlotDropAcquired(); |
||||
} |
||||
|
||||
UnlockSharedObject(DatabaseRelationId, local_slot->data.database, |
||||
0, AccessShareLock); |
||||
|
||||
ereport(LOG, |
||||
errmsg("dropped replication slot \"%s\" of dbid %d", |
||||
NameStr(local_slot->data.name), |
||||
local_slot->data.database)); |
||||
} |
||||
} |
||||
} |
||||
|
||||
/*
|
||||
* Reserve WAL for the currently active local slot using the specified WAL |
||||
* location (restart_lsn). |
||||
* |
||||
* If the given WAL location has been removed, reserve WAL using the oldest |
||||
* existing WAL segment. |
||||
*/ |
||||
static void |
||||
reserve_wal_for_local_slot(XLogRecPtr restart_lsn) |
||||
{ |
||||
XLogSegNo oldest_segno; |
||||
XLogSegNo segno; |
||||
ReplicationSlot *slot = MyReplicationSlot; |
||||
|
||||
Assert(slot != NULL); |
||||
Assert(XLogRecPtrIsInvalid(slot->data.restart_lsn)); |
||||
|
||||
while (true) |
||||
{ |
||||
SpinLockAcquire(&slot->mutex); |
||||
slot->data.restart_lsn = restart_lsn; |
||||
SpinLockRelease(&slot->mutex); |
||||
|
||||
/* Prevent WAL removal as fast as possible */ |
||||
ReplicationSlotsComputeRequiredLSN(); |
||||
|
||||
XLByteToSeg(slot->data.restart_lsn, segno, wal_segment_size); |
||||
|
||||
/*
|
||||
* Find the oldest existing WAL segment file. |
||||
* |
||||
* Normally, we can determine it by using the last removed segment |
||||
* number. However, if no WAL segment files have been removed by a |
||||
* checkpoint since startup, we need to search for the oldest segment |
||||
* file from the current timeline existing in XLOGDIR. |
||||
* |
||||
* XXX: Currently, we are searching for the oldest segment in the |
||||
* current timeline as there is less chance of the slot's restart_lsn |
||||
* from being some prior timeline, and even if it happens, in the |
||||
* worst case, we will wait to sync till the slot's restart_lsn moved |
||||
* to the current timeline. |
||||
*/ |
||||
oldest_segno = XLogGetLastRemovedSegno() + 1; |
||||
|
||||
if (oldest_segno == 1) |
||||
{ |
||||
TimeLineID cur_timeline; |
||||
|
||||
GetWalRcvFlushRecPtr(NULL, &cur_timeline); |
||||
oldest_segno = XLogGetOldestSegno(cur_timeline); |
||||
} |
||||
|
||||
/*
|
||||
* If all required WAL is still there, great, otherwise retry. The |
||||
* slot should prevent further removal of WAL, unless there's a |
||||
* concurrent ReplicationSlotsComputeRequiredLSN() after we've written |
||||
* the new restart_lsn above, so normally we should never need to loop |
||||
* more than twice. |
||||
*/ |
||||
if (segno >= oldest_segno) |
||||
break; |
||||
|
||||
/* Retry using the location of the oldest wal segment */ |
||||
XLogSegNoOffsetToRecPtr(oldest_segno, 0, wal_segment_size, restart_lsn); |
||||
} |
||||
} |
||||
|
||||
/*
|
||||
* If the remote restart_lsn and catalog_xmin have caught up with the |
||||
* local ones, then update the LSNs and persist the local synced slot for |
||||
* future synchronization; otherwise, do nothing. |
||||
*/ |
||||
static void |
||||
update_and_persist_local_synced_slot(RemoteSlot *remote_slot, Oid remote_dbid) |
||||
{ |
||||
ReplicationSlot *slot = MyReplicationSlot; |
||||
|
||||
/*
|
||||
* Check if the primary server has caught up. Refer to the comment atop |
||||
* the file for details on this check. |
||||
*/ |
||||
if (remote_slot->restart_lsn < slot->data.restart_lsn || |
||||
TransactionIdPrecedes(remote_slot->catalog_xmin, |
||||
slot->data.catalog_xmin)) |
||||
{ |
||||
/*
|
||||
* The remote slot didn't catch up to locally reserved position. |
||||
* |
||||
* We do not drop the slot because the restart_lsn can be ahead of the |
||||
* current location when recreating the slot in the next cycle. It may |
||||
* take more time to create such a slot. Therefore, we keep this slot |
||||
* and attempt the synchronization in the next cycle. |
||||
*/ |
||||
return; |
||||
} |
||||
|
||||
/* First time slot update, the function must return true */ |
||||
if (!update_local_synced_slot(remote_slot, remote_dbid)) |
||||
elog(ERROR, "failed to update slot"); |
||||
|
||||
ReplicationSlotPersist(); |
||||
|
||||
ereport(LOG, |
||||
errmsg("newly created slot \"%s\" is sync-ready now", |
||||
remote_slot->name)); |
||||
} |
||||
|
||||
/*
|
||||
* Synchronize a single slot to the given position. |
||||
* |
||||
* This creates a new slot if there is no existing one and updates the |
||||
* metadata of the slot as per the data received from the primary server. |
||||
* |
||||
* The slot is created as a temporary slot and stays in the same state until the |
||||
* the remote_slot catches up with locally reserved position and local slot is |
||||
* updated. The slot is then persisted and is considered as sync-ready for |
||||
* periodic syncs. |
||||
*/ |
||||
static void |
||||
synchronize_one_slot(RemoteSlot *remote_slot, Oid remote_dbid) |
||||
{ |
||||
ReplicationSlot *slot; |
||||
XLogRecPtr latestFlushPtr; |
||||
|
||||
/*
|
||||
* Make sure that concerned WAL is received and flushed before syncing |
||||
* slot to target lsn received from the primary server. |
||||
*/ |
||||
latestFlushPtr = GetStandbyFlushRecPtr(NULL); |
||||
if (remote_slot->confirmed_lsn > latestFlushPtr) |
||||
elog(ERROR, |
||||
"skipping slot synchronization as the received slot sync" |
||||
" LSN %X/%X for slot \"%s\" is ahead of the standby position %X/%X", |
||||
LSN_FORMAT_ARGS(remote_slot->confirmed_lsn), |
||||
remote_slot->name, |
||||
LSN_FORMAT_ARGS(latestFlushPtr)); |
||||
|
||||
/* Search for the named slot */ |
||||
if ((slot = SearchNamedReplicationSlot(remote_slot->name, true))) |
||||
{ |
||||
bool synced; |
||||
|
||||
SpinLockAcquire(&slot->mutex); |
||||
synced = slot->data.synced; |
||||
SpinLockRelease(&slot->mutex); |
||||
|
||||
/* User-created slot with the same name exists, raise ERROR. */ |
||||
if (!synced) |
||||
ereport(ERROR, |
||||
errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE), |
||||
errmsg("exiting from slot synchronization because same" |
||||
" name slot \"%s\" already exists on the standby", |
||||
remote_slot->name)); |
||||
|
||||
/*
|
||||
* The slot has been synchronized before. |
||||
* |
||||
* It is important to acquire the slot here before checking |
||||
* invalidation. If we don't acquire the slot first, there could be a |
||||
* race condition that the local slot could be invalidated just after |
||||
* checking the 'invalidated' flag here and we could end up |
||||
* overwriting 'invalidated' flag to remote_slot's value. See |
||||
* InvalidatePossiblyObsoleteSlot() where it invalidates slot directly |
||||
* if the slot is not acquired by other processes. |
||||
*/ |
||||
ReplicationSlotAcquire(remote_slot->name, true); |
||||
|
||||
Assert(slot == MyReplicationSlot); |
||||
|
||||
/*
|
||||
* Copy the invalidation cause from remote only if local slot is not |
||||
* invalidated locally, we don't want to overwrite existing one. |
||||
*/ |
||||
if (slot->data.invalidated == RS_INVAL_NONE && |
||||
remote_slot->invalidated != RS_INVAL_NONE) |
||||
{ |
||||
SpinLockAcquire(&slot->mutex); |
||||
slot->data.invalidated = remote_slot->invalidated; |
||||
SpinLockRelease(&slot->mutex); |
||||
|
||||
/* Make sure the invalidated state persists across server restart */ |
||||
ReplicationSlotMarkDirty(); |
||||
ReplicationSlotSave(); |
||||
} |
||||
|
||||
/* Skip the sync of an invalidated slot */ |
||||
if (slot->data.invalidated != RS_INVAL_NONE) |
||||
{ |
||||
ReplicationSlotRelease(); |
||||
return; |
||||
} |
||||
|
||||
/* Slot not ready yet, let's attempt to make it sync-ready now. */ |
||||
if (slot->data.persistency == RS_TEMPORARY) |
||||
{ |
||||
update_and_persist_local_synced_slot(remote_slot, remote_dbid); |
||||
} |
||||
|
||||
/* Slot ready for sync, so sync it. */ |
||||
else |
||||
{ |
||||
/*
|
||||
* Sanity check: As long as the invalidations are handled |
||||
* appropriately as above, this should never happen. |
||||
*/ |
||||
if (remote_slot->restart_lsn < slot->data.restart_lsn) |
||||
elog(ERROR, |
||||
"cannot synchronize local slot \"%s\" LSN(%X/%X)" |
||||
" to remote slot's LSN(%X/%X) as synchronization" |
||||
" would move it backwards", remote_slot->name, |
||||
LSN_FORMAT_ARGS(slot->data.restart_lsn), |
||||
LSN_FORMAT_ARGS(remote_slot->restart_lsn)); |
||||
|
||||
/* Make sure the slot changes persist across server restart */ |
||||
if (update_local_synced_slot(remote_slot, remote_dbid)) |
||||
{ |
||||
ReplicationSlotMarkDirty(); |
||||
ReplicationSlotSave(); |
||||
} |
||||
} |
||||
} |
||||
/* Otherwise create the slot first. */ |
||||
else |
||||
{ |
||||
NameData plugin_name; |
||||
TransactionId xmin_horizon = InvalidTransactionId; |
||||
|
||||
/* Skip creating the local slot if remote_slot is invalidated already */ |
||||
if (remote_slot->invalidated != RS_INVAL_NONE) |
||||
return; |
||||
|
||||
/*
|
||||
* We create temporary slots instead of ephemeral slots here because |
||||
* we want the slots to survive after releasing them. This is done to |
||||
* avoid dropping and re-creating the slots in each synchronization |
||||
* cycle if the restart_lsn or catalog_xmin of the remote slot has not |
||||
* caught up. |
||||
*/ |
||||
ReplicationSlotCreate(remote_slot->name, true, RS_TEMPORARY, |
||||
remote_slot->two_phase, |
||||
remote_slot->failover, |
||||
true); |
||||
|
||||
/* For shorter lines. */ |
||||
slot = MyReplicationSlot; |
||||
|
||||
/* Avoid expensive operations while holding a spinlock. */ |
||||
namestrcpy(&plugin_name, remote_slot->plugin); |
||||
|
||||
SpinLockAcquire(&slot->mutex); |
||||
slot->data.database = remote_dbid; |
||||
slot->data.plugin = plugin_name; |
||||
SpinLockRelease(&slot->mutex); |
||||
|
||||
reserve_wal_for_local_slot(remote_slot->restart_lsn); |
||||
|
||||
LWLockAcquire(ProcArrayLock, LW_EXCLUSIVE); |
||||
xmin_horizon = GetOldestSafeDecodingTransactionId(true); |
||||
SpinLockAcquire(&slot->mutex); |
||||
slot->effective_catalog_xmin = xmin_horizon; |
||||
slot->data.catalog_xmin = xmin_horizon; |
||||
SpinLockRelease(&slot->mutex); |
||||
ReplicationSlotsComputeRequiredXmin(true); |
||||
LWLockRelease(ProcArrayLock); |
||||
|
||||
update_and_persist_local_synced_slot(remote_slot, remote_dbid); |
||||
} |
||||
|
||||
ReplicationSlotRelease(); |
||||
} |
||||
|
||||
/*
|
||||
* Synchronize slots. |
||||
* |
||||
* Gets the failover logical slots info from the primary server and updates |
||||
* the slots locally. Creates the slots if not present on the standby. |
||||
*/ |
||||
static void |
||||
synchronize_slots(WalReceiverConn *wrconn) |
||||
{ |
||||
#define SLOTSYNC_COLUMN_COUNT 9 |
||||
Oid slotRow[SLOTSYNC_COLUMN_COUNT] = {TEXTOID, TEXTOID, LSNOID, |
||||
LSNOID, XIDOID, BOOLOID, BOOLOID, TEXTOID, TEXTOID}; |
||||
|
||||
WalRcvExecResult *res; |
||||
TupleTableSlot *tupslot; |
||||
StringInfoData s; |
||||
List *remote_slot_list = NIL; |
||||
|
||||
SpinLockAcquire(&SlotSyncCtx->mutex); |
||||
if (SlotSyncCtx->syncing) |
||||
{ |
||||
SpinLockRelease(&SlotSyncCtx->mutex); |
||||
ereport(ERROR, |
||||
errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE), |
||||
errmsg("cannot synchronize replication slots concurrently")); |
||||
} |
||||
|
||||
SlotSyncCtx->syncing = true; |
||||
SpinLockRelease(&SlotSyncCtx->mutex); |
||||
|
||||
syncing_slots = true; |
||||
|
||||
initStringInfo(&s); |
||||
|
||||
/* Construct query to fetch slots with failover enabled. */ |
||||
appendStringInfo(&s, |
||||
"SELECT slot_name, plugin, confirmed_flush_lsn," |
||||
" restart_lsn, catalog_xmin, two_phase, failover," |
||||
" database, conflict_reason" |
||||
" FROM pg_catalog.pg_replication_slots" |
||||
" WHERE failover and NOT temporary"); |
||||
|
||||
/* Execute the query */ |
||||
res = walrcv_exec(wrconn, s.data, SLOTSYNC_COLUMN_COUNT, slotRow); |
||||
pfree(s.data); |
||||
|
||||
if (res->status != WALRCV_OK_TUPLES) |
||||
ereport(ERROR, |
||||
errmsg("could not fetch failover logical slots info from the primary server: %s", |
||||
res->err)); |
||||
|
||||
/* Construct the remote_slot tuple and synchronize each slot locally */ |
||||
tupslot = MakeSingleTupleTableSlot(res->tupledesc, &TTSOpsMinimalTuple); |
||||
while (tuplestore_gettupleslot(res->tuplestore, true, false, tupslot)) |
||||
{ |
||||
bool isnull; |
||||
RemoteSlot *remote_slot = palloc0(sizeof(RemoteSlot)); |
||||
Datum d; |
||||
int col = 0; |
||||
|
||||
remote_slot->name = TextDatumGetCString(slot_getattr(tupslot, ++col, |
||||
&isnull)); |
||||
Assert(!isnull); |
||||
|
||||
remote_slot->plugin = TextDatumGetCString(slot_getattr(tupslot, ++col, |
||||
&isnull)); |
||||
Assert(!isnull); |
||||
|
||||
/*
|
||||
* It is possible to get null values for LSN and Xmin if slot is |
||||
* invalidated on the primary server, so handle accordingly. |
||||
*/ |
||||
d = slot_getattr(tupslot, ++col, &isnull); |
||||
remote_slot->confirmed_lsn = isnull ? InvalidXLogRecPtr : |
||||
DatumGetLSN(d); |
||||
|
||||
d = slot_getattr(tupslot, ++col, &isnull); |
||||
remote_slot->restart_lsn = isnull ? InvalidXLogRecPtr : DatumGetLSN(d); |
||||
|
||||
d = slot_getattr(tupslot, ++col, &isnull); |
||||
remote_slot->catalog_xmin = isnull ? InvalidTransactionId : |
||||
DatumGetTransactionId(d); |
||||
|
||||
remote_slot->two_phase = DatumGetBool(slot_getattr(tupslot, ++col, |
||||
&isnull)); |
||||
Assert(!isnull); |
||||
|
||||
remote_slot->failover = DatumGetBool(slot_getattr(tupslot, ++col, |
||||
&isnull)); |
||||
Assert(!isnull); |
||||
|
||||
remote_slot->database = TextDatumGetCString(slot_getattr(tupslot, |
||||
++col, &isnull)); |
||||
Assert(!isnull); |
||||
|
||||
d = slot_getattr(tupslot, ++col, &isnull); |
||||
remote_slot->invalidated = isnull ? RS_INVAL_NONE : |
||||
GetSlotInvalidationCause(TextDatumGetCString(d)); |
||||
|
||||
/* Sanity check */ |
||||
Assert(col == SLOTSYNC_COLUMN_COUNT); |
||||
|
||||
/*
|
||||
* If restart_lsn, confirmed_lsn or catalog_xmin is invalid but the |
||||
* slot is valid, that means we have fetched the remote_slot in its |
||||
* RS_EPHEMERAL state. In such a case, don't sync it; we can always |
||||
* sync it in the next sync cycle when the remote_slot is persisted |
||||
* and has valid lsn(s) and xmin values. |
||||
* |
||||
* XXX: In future, if we plan to expose 'slot->data.persistency' in |
||||
* pg_replication_slots view, then we can avoid fetching RS_EPHEMERAL |
||||
* slots in the first place. |
||||
*/ |
||||
if ((XLogRecPtrIsInvalid(remote_slot->restart_lsn) || |
||||
XLogRecPtrIsInvalid(remote_slot->confirmed_lsn) || |
||||
!TransactionIdIsValid(remote_slot->catalog_xmin)) && |
||||
remote_slot->invalidated == RS_INVAL_NONE) |
||||
pfree(remote_slot); |
||||
else |
||||
/* Create list of remote slots */ |
||||
remote_slot_list = lappend(remote_slot_list, remote_slot); |
||||
|
||||
ExecClearTuple(tupslot); |
||||
} |
||||
|
||||
/* Drop local slots that no longer need to be synced. */ |
||||
drop_local_obsolete_slots(remote_slot_list); |
||||
|
||||
/* Now sync the slots locally */ |
||||
foreach_ptr(RemoteSlot, remote_slot, remote_slot_list) |
||||
{ |
||||
Oid remote_dbid = get_database_oid(remote_slot->database, false); |
||||
|
||||
/*
|
||||
* Use shared lock to prevent a conflict with |
||||
* ReplicationSlotsDropDBSlots(), trying to drop the same slot during |
||||
* a drop-database operation. |
||||
*/ |
||||
LockSharedObject(DatabaseRelationId, remote_dbid, 0, AccessShareLock); |
||||
|
||||
synchronize_one_slot(remote_slot, remote_dbid); |
||||
|
||||
UnlockSharedObject(DatabaseRelationId, remote_dbid, 0, AccessShareLock); |
||||
} |
||||
|
||||
/* We are done, free remote_slot_list elements */ |
||||
list_free_deep(remote_slot_list); |
||||
|
||||
walrcv_clear_result(res); |
||||
|
||||
SpinLockAcquire(&SlotSyncCtx->mutex); |
||||
SlotSyncCtx->syncing = false; |
||||
SpinLockRelease(&SlotSyncCtx->mutex); |
||||
|
||||
syncing_slots = false; |
||||
} |
||||
|
||||
/*
|
||||
* Checks the remote server info. |
||||
* |
||||
* We ensure that the 'primary_slot_name' exists on the remote server and the |
||||
* remote server is not a standby node. |
||||
*/ |
||||
static void |
||||
validate_remote_info(WalReceiverConn *wrconn) |
||||
{ |
||||
#define PRIMARY_INFO_OUTPUT_COL_COUNT 2 |
||||
WalRcvExecResult *res; |
||||
Oid slotRow[PRIMARY_INFO_OUTPUT_COL_COUNT] = {BOOLOID, BOOLOID}; |
||||
StringInfoData cmd; |
||||
bool isnull; |
||||
TupleTableSlot *tupslot; |
||||
bool remote_in_recovery; |
||||
bool primary_slot_valid; |
||||
|
||||
initStringInfo(&cmd); |
||||
appendStringInfo(&cmd, |
||||
"SELECT pg_is_in_recovery(), count(*) = 1" |
||||
" FROM pg_catalog.pg_replication_slots" |
||||
" WHERE slot_type='physical' AND slot_name=%s", |
||||
quote_literal_cstr(PrimarySlotName)); |
||||
|
||||
res = walrcv_exec(wrconn, cmd.data, PRIMARY_INFO_OUTPUT_COL_COUNT, slotRow); |
||||
pfree(cmd.data); |
||||
|
||||
if (res->status != WALRCV_OK_TUPLES) |
||||
ereport(ERROR, |
||||
errmsg("could not fetch primary_slot_name \"%s\" info from the primary server: %s", |
||||
PrimarySlotName, res->err), |
||||
errhint("Check if \"primary_slot_name\" is configured correctly.")); |
||||
|
||||
tupslot = MakeSingleTupleTableSlot(res->tupledesc, &TTSOpsMinimalTuple); |
||||
if (!tuplestore_gettupleslot(res->tuplestore, true, false, tupslot)) |
||||
elog(ERROR, |
||||
"failed to fetch tuple for the primary server slot specified by \"primary_slot_name\""); |
||||
|
||||
remote_in_recovery = DatumGetBool(slot_getattr(tupslot, 1, &isnull)); |
||||
Assert(!isnull); |
||||
|
||||
if (remote_in_recovery) |
||||
ereport(ERROR, |
||||
errcode(ERRCODE_FEATURE_NOT_SUPPORTED), |
||||
errmsg("cannot synchronize replication slots from a standby server")); |
||||
|
||||
primary_slot_valid = DatumGetBool(slot_getattr(tupslot, 2, &isnull)); |
||||
Assert(!isnull); |
||||
|
||||
if (!primary_slot_valid) |
||||
ereport(ERROR, |
||||
errcode(ERRCODE_INVALID_PARAMETER_VALUE), |
||||
errmsg("bad configuration for slot synchronization"), |
||||
/* translator: second %s is a GUC variable name */ |
||||
errdetail("The replication slot \"%s\" specified by \"%s\" does not exist on the primary server.", |
||||
PrimarySlotName, "primary_slot_name")); |
||||
|
||||
ExecClearTuple(tupslot); |
||||
walrcv_clear_result(res); |
||||
} |
||||
|
||||
/*
|
||||
* Check all necessary GUCs for slot synchronization are set |
||||
* appropriately, otherwise, raise ERROR. |
||||
*/ |
||||
void |
||||
ValidateSlotSyncParams(void) |
||||
{ |
||||
char *dbname; |
||||
|
||||
/*
|
||||
* A physical replication slot(primary_slot_name) is required on the |
||||
* primary to ensure that the rows needed by the standby are not removed |
||||
* after restarting, so that the synchronized slot on the standby will not |
||||
* be invalidated. |
||||
*/ |
||||
if (PrimarySlotName == NULL || *PrimarySlotName == '\0') |
||||
ereport(ERROR, |
||||
/* translator: %s is a GUC variable name */ |
||||
errcode(ERRCODE_INVALID_PARAMETER_VALUE), |
||||
errmsg("bad configuration for slot synchronization"), |
||||
errhint("\"%s\" must be defined.", "primary_slot_name")); |
||||
|
||||
/*
|
||||
* hot_standby_feedback must be enabled to cooperate with the physical |
||||
* replication slot, which allows informing the primary about the xmin and |
||||
* catalog_xmin values on the standby. |
||||
*/ |
||||
if (!hot_standby_feedback) |
||||
ereport(ERROR, |
||||
/* translator: %s is a GUC variable name */ |
||||
errcode(ERRCODE_INVALID_PARAMETER_VALUE), |
||||
errmsg("bad configuration for slot synchronization"), |
||||
errhint("\"%s\" must be enabled.", "hot_standby_feedback")); |
||||
|
||||
/* Logical slot sync/creation requires wal_level >= logical. */ |
||||
if (wal_level < WAL_LEVEL_LOGICAL) |
||||
ereport(ERROR, |
||||
errcode(ERRCODE_INVALID_PARAMETER_VALUE), |
||||
errmsg("bad configuration for slot synchronization"), |
||||
errhint("\"wal_level\" must be >= logical.")); |
||||
|
||||
/*
|
||||
* The primary_conninfo is required to make connection to primary for |
||||
* getting slots information. |
||||
*/ |
||||
if (PrimaryConnInfo == NULL || *PrimaryConnInfo == '\0') |
||||
ereport(ERROR, |
||||
/* translator: %s is a GUC variable name */ |
||||
errcode(ERRCODE_INVALID_PARAMETER_VALUE), |
||||
errmsg("bad configuration for slot synchronization"), |
||||
errhint("\"%s\" must be defined.", "primary_conninfo")); |
||||
|
||||
/*
|
||||
* The slot synchronization needs a database connection for walrcv_exec to |
||||
* work. |
||||
*/ |
||||
dbname = walrcv_get_dbname_from_conninfo(PrimaryConnInfo); |
||||
if (dbname == NULL) |
||||
ereport(ERROR, |
||||
|
||||
/*
|
||||
* translator: 'dbname' is a specific option; %s is a GUC variable |
||||
* name |
||||
*/ |
||||
errcode(ERRCODE_INVALID_PARAMETER_VALUE), |
||||
errmsg("bad configuration for slot synchronization"), |
||||
errhint("'dbname' must be specified in \"%s\".", "primary_conninfo")); |
||||
} |
||||
|
||||
/*
|
||||
* Is current process syncing replication slots ? |
||||
*/ |
||||
bool |
||||
IsSyncingReplicationSlots(void) |
||||
{ |
||||
return syncing_slots; |
||||
} |
||||
|
||||
/*
|
||||
* Amount of shared memory required for slot synchronization. |
||||
*/ |
||||
Size |
||||
SlotSyncShmemSize(void) |
||||
{ |
||||
return sizeof(SlotSyncCtxStruct); |
||||
} |
||||
|
||||
/*
|
||||
* Allocate and initialize the shared memory of slot synchronization. |
||||
*/ |
||||
void |
||||
SlotSyncShmemInit(void) |
||||
{ |
||||
bool found; |
||||
|
||||
SlotSyncCtx = (SlotSyncCtxStruct *) |
||||
ShmemInitStruct("Slot Sync Data", SlotSyncShmemSize(), &found); |
||||
|
||||
if (!found) |
||||
{ |
||||
SlotSyncCtx->syncing = false; |
||||
SpinLockInit(&SlotSyncCtx->mutex); |
||||
} |
||||
} |
||||
|
||||
/*
|
||||
* Error cleanup callback for slot synchronization. |
||||
*/ |
||||
static void |
||||
slotsync_failure_callback(int code, Datum arg) |
||||
{ |
||||
WalReceiverConn *wrconn = (WalReceiverConn *) DatumGetPointer(arg); |
||||
|
||||
if (syncing_slots) |
||||
{ |
||||
/*
|
||||
* If syncing_slots is true, it indicates that the process errored out |
||||
* without resetting the flag. So, we need to clean up shared memory |
||||
* and reset the flag here. |
||||
*/ |
||||
SpinLockAcquire(&SlotSyncCtx->mutex); |
||||
SlotSyncCtx->syncing = false; |
||||
SpinLockRelease(&SlotSyncCtx->mutex); |
||||
|
||||
syncing_slots = false; |
||||
} |
||||
|
||||
walrcv_disconnect(wrconn); |
||||
} |
||||
|
||||
/*
|
||||
* Synchronize the failover enabled replication slots using the specified |
||||
* primary server connection. |
||||
*/ |
||||
void |
||||
SyncReplicationSlots(WalReceiverConn *wrconn) |
||||
{ |
||||
PG_ENSURE_ERROR_CLEANUP(slotsync_failure_callback, PointerGetDatum(wrconn)); |
||||
{ |
||||
validate_remote_info(wrconn); |
||||
|
||||
synchronize_slots(wrconn); |
||||
} |
||||
PG_END_ENSURE_ERROR_CLEANUP(slotsync_failure_callback, PointerGetDatum(wrconn)); |
||||
} |
@ -0,0 +1,23 @@ |
||||
/*-------------------------------------------------------------------------
|
||||
* |
||||
* slotsync.h |
||||
* Exports for slot synchronization. |
||||
* |
||||
* Portions Copyright (c) 2016-2024, PostgreSQL Global Development Group |
||||
* |
||||
* src/include/replication/slotsync.h |
||||
* |
||||
*------------------------------------------------------------------------- |
||||
*/ |
||||
#ifndef SLOTSYNC_H |
||||
#define SLOTSYNC_H |
||||
|
||||
#include "replication/walreceiver.h" |
||||
|
||||
extern void ValidateSlotSyncParams(void); |
||||
extern bool IsSyncingReplicationSlots(void); |
||||
extern Size SlotSyncShmemSize(void); |
||||
extern void SlotSyncShmemInit(void); |
||||
extern void SyncReplicationSlots(WalReceiverConn *wrconn); |
||||
|
||||
#endif /* SLOTSYNC_H */ |
Loading…
Reference in new issue