mirror of https://github.com/postgres/postgres
You can not select more than 25 topics
Topics must start with a letter or number, can include dashes ('-') and can be up to 35 characters long.
1809 lines
54 KiB
1809 lines
54 KiB
/*-------------------------------------------------------------------------
|
|
* slotsync.c
|
|
* Functionality for synchronizing slots to a standby server from the
|
|
* primary server.
|
|
*
|
|
* Copyright (c) 2024-2025, PostgreSQL Global Development Group
|
|
*
|
|
* IDENTIFICATION
|
|
* src/backend/replication/logical/slotsync.c
|
|
*
|
|
* This file contains the code for slot synchronization on a physical standby
|
|
* to fetch logical failover slots information from the primary server, create
|
|
* the slots on the standby and synchronize them periodically.
|
|
*
|
|
* Slot synchronization can be performed either automatically by enabling slot
|
|
* sync worker or manually by calling SQL function pg_sync_replication_slots().
|
|
*
|
|
* If the WAL corresponding to the remote's restart_lsn is not available on the
|
|
* physical standby or the remote's catalog_xmin precedes the oldest xid for
|
|
* which it is guaranteed that rows wouldn't have been removed then we cannot
|
|
* create the local standby slot because that would mean moving the local slot
|
|
* backward and decoding won't be possible via such a slot. In this case, the
|
|
* slot will be marked as RS_TEMPORARY. Once the primary server catches up,
|
|
* the slot will be marked as RS_PERSISTENT (which means sync-ready) after
|
|
* which slot sync worker can perform the sync periodically or user can call
|
|
* pg_sync_replication_slots() periodically to perform the syncs.
|
|
*
|
|
* If synchronized slots fail to build a consistent snapshot from the
|
|
* restart_lsn before reaching confirmed_flush_lsn, they would become
|
|
* unreliable after promotion due to potential data loss from changes
|
|
* before reaching a consistent point. This can happen because the slots can
|
|
* be synced at some random time and we may not reach the consistent point
|
|
* at the same WAL location as the primary. So, we mark such slots as
|
|
* RS_TEMPORARY. Once the decoding from corresponding LSNs can reach a
|
|
* consistent point, they will be marked as RS_PERSISTENT.
|
|
*
|
|
* The slot sync worker waits for some time before the next synchronization,
|
|
* with the duration varying based on whether any slots were updated during
|
|
* the last cycle. Refer to the comments above wait_for_slot_activity() for
|
|
* more details.
|
|
*
|
|
* Any standby synchronized slots will be dropped if they no longer need
|
|
* to be synchronized. See comment atop drop_local_obsolete_slots() for more
|
|
* details.
|
|
*---------------------------------------------------------------------------
|
|
*/
|
|
|
|
#include "postgres.h"
|
|
|
|
#include <time.h>
|
|
|
|
#include "access/xlog_internal.h"
|
|
#include "access/xlogrecovery.h"
|
|
#include "catalog/pg_database.h"
|
|
#include "libpq/pqsignal.h"
|
|
#include "pgstat.h"
|
|
#include "postmaster/interrupt.h"
|
|
#include "replication/logical.h"
|
|
#include "replication/slotsync.h"
|
|
#include "replication/snapbuild.h"
|
|
#include "storage/ipc.h"
|
|
#include "storage/lmgr.h"
|
|
#include "storage/proc.h"
|
|
#include "storage/procarray.h"
|
|
#include "tcop/tcopprot.h"
|
|
#include "utils/builtins.h"
|
|
#include "utils/pg_lsn.h"
|
|
#include "utils/ps_status.h"
|
|
#include "utils/timeout.h"
|
|
|
|
/*
|
|
* Struct for sharing information to control slot synchronization.
|
|
*
|
|
* The slot sync worker's pid is needed by the startup process to shut it
|
|
* down during promotion. The startup process shuts down the slot sync worker
|
|
* and also sets stopSignaled=true to handle the race condition when the
|
|
* postmaster has not noticed the promotion yet and thus may end up restarting
|
|
* the slot sync worker. If stopSignaled is set, the worker will exit in such a
|
|
* case. The SQL function pg_sync_replication_slots() will also error out if
|
|
* this flag is set. Note that we don't need to reset this variable as after
|
|
* promotion the slot sync worker won't be restarted because the pmState
|
|
* changes to PM_RUN from PM_HOT_STANDBY and we don't support demoting
|
|
* primary without restarting the server. See LaunchMissingBackgroundProcesses.
|
|
*
|
|
* The 'syncing' flag is needed to prevent concurrent slot syncs to avoid slot
|
|
* overwrites.
|
|
*
|
|
* The 'last_start_time' is needed by postmaster to start the slot sync worker
|
|
* once per SLOTSYNC_RESTART_INTERVAL_SEC. In cases where an immediate restart
|
|
* is expected (e.g., slot sync GUCs change), slot sync worker will reset
|
|
* last_start_time before exiting, so that postmaster can start the worker
|
|
* without waiting for SLOTSYNC_RESTART_INTERVAL_SEC.
|
|
*/
|
|
typedef struct SlotSyncCtxStruct
|
|
{
|
|
pid_t pid;
|
|
bool stopSignaled;
|
|
bool syncing;
|
|
time_t last_start_time;
|
|
slock_t mutex;
|
|
} SlotSyncCtxStruct;
|
|
|
|
static SlotSyncCtxStruct *SlotSyncCtx = NULL;
|
|
|
|
/* GUC variable */
|
|
bool sync_replication_slots = false;
|
|
|
|
/*
|
|
* The sleep time (ms) between slot-sync cycles varies dynamically
|
|
* (within a MIN/MAX range) according to slot activity. See
|
|
* wait_for_slot_activity() for details.
|
|
*/
|
|
#define MIN_SLOTSYNC_WORKER_NAPTIME_MS 200
|
|
#define MAX_SLOTSYNC_WORKER_NAPTIME_MS 30000 /* 30s */
|
|
|
|
static long sleep_ms = MIN_SLOTSYNC_WORKER_NAPTIME_MS;
|
|
|
|
/* The restart interval for slot sync work used by postmaster */
|
|
#define SLOTSYNC_RESTART_INTERVAL_SEC 10
|
|
|
|
/*
|
|
* Flag to tell if we are syncing replication slots. Unlike the 'syncing' flag
|
|
* in SlotSyncCtxStruct, this flag is true only if the current process is
|
|
* performing slot synchronization.
|
|
*/
|
|
static bool syncing_slots = false;
|
|
|
|
/*
|
|
* Structure to hold information fetched from the primary server about a logical
|
|
* replication slot.
|
|
*/
|
|
typedef struct RemoteSlot
|
|
{
|
|
char *name;
|
|
char *plugin;
|
|
char *database;
|
|
bool two_phase;
|
|
bool failover;
|
|
XLogRecPtr restart_lsn;
|
|
XLogRecPtr confirmed_lsn;
|
|
XLogRecPtr two_phase_at;
|
|
TransactionId catalog_xmin;
|
|
|
|
/* RS_INVAL_NONE if valid, or the reason of invalidation */
|
|
ReplicationSlotInvalidationCause invalidated;
|
|
} RemoteSlot;
|
|
|
|
static void slotsync_failure_callback(int code, Datum arg);
|
|
static void update_synced_slots_inactive_since(void);
|
|
|
|
/*
|
|
* If necessary, update the local synced slot's metadata based on the data
|
|
* from the remote slot.
|
|
*
|
|
* If no update was needed (the data of the remote slot is the same as the
|
|
* local slot) return false, otherwise true.
|
|
*
|
|
* *found_consistent_snapshot will be true iff the remote slot's LSN or xmin is
|
|
* modified, and decoding from the corresponding LSN's can reach a
|
|
* consistent snapshot.
|
|
*
|
|
* *remote_slot_precedes will be true if the remote slot's LSN or xmin
|
|
* precedes locally reserved position.
|
|
*/
|
|
static bool
|
|
update_local_synced_slot(RemoteSlot *remote_slot, Oid remote_dbid,
|
|
bool *found_consistent_snapshot,
|
|
bool *remote_slot_precedes)
|
|
{
|
|
ReplicationSlot *slot = MyReplicationSlot;
|
|
bool updated_xmin_or_lsn = false;
|
|
bool updated_config = false;
|
|
|
|
Assert(slot->data.invalidated == RS_INVAL_NONE);
|
|
|
|
if (found_consistent_snapshot)
|
|
*found_consistent_snapshot = false;
|
|
|
|
if (remote_slot_precedes)
|
|
*remote_slot_precedes = false;
|
|
|
|
/*
|
|
* Don't overwrite if we already have a newer catalog_xmin and
|
|
* restart_lsn.
|
|
*/
|
|
if (remote_slot->restart_lsn < slot->data.restart_lsn ||
|
|
TransactionIdPrecedes(remote_slot->catalog_xmin,
|
|
slot->data.catalog_xmin))
|
|
{
|
|
/* Update slot sync skip stats */
|
|
pgstat_report_replslotsync(slot);
|
|
|
|
/*
|
|
* This can happen in following situations:
|
|
*
|
|
* If the slot is temporary, it means either the initial WAL location
|
|
* reserved for the local slot is ahead of the remote slot's
|
|
* restart_lsn or the initial xmin_horizon computed for the local slot
|
|
* is ahead of the remote slot.
|
|
*
|
|
* If the slot is persistent, both restart_lsn and catalog_xmin of the
|
|
* synced slot could still be ahead of the remote slot. Since we use
|
|
* slot advance functionality to keep snapbuild/slot updated, it is
|
|
* possible that the restart_lsn and catalog_xmin are advanced to a
|
|
* later position than it has on the primary. This can happen when
|
|
* slot advancing machinery finds running xacts record after reaching
|
|
* the consistent state at a later point than the primary where it
|
|
* serializes the snapshot and updates the restart_lsn.
|
|
*
|
|
* We LOG the message if the slot is temporary as it can help the user
|
|
* to understand why the slot is not sync-ready. In the case of a
|
|
* persistent slot, it would be a more common case and won't directly
|
|
* impact the users, so we used DEBUG1 level to log the message.
|
|
*/
|
|
ereport(slot->data.persistency == RS_TEMPORARY ? LOG : DEBUG1,
|
|
errmsg("could not synchronize replication slot \"%s\"",
|
|
remote_slot->name),
|
|
errdetail("Synchronization could lead to data loss, because the remote slot needs WAL at LSN %X/%08X and catalog xmin %u, but the standby has LSN %X/%08X and catalog xmin %u.",
|
|
LSN_FORMAT_ARGS(remote_slot->restart_lsn),
|
|
remote_slot->catalog_xmin,
|
|
LSN_FORMAT_ARGS(slot->data.restart_lsn),
|
|
slot->data.catalog_xmin));
|
|
|
|
if (remote_slot_precedes)
|
|
*remote_slot_precedes = true;
|
|
|
|
/*
|
|
* Skip updating the configuration. This is required to avoid syncing
|
|
* two_phase_at without syncing confirmed_lsn. Otherwise, the prepared
|
|
* transaction between old confirmed_lsn and two_phase_at will
|
|
* unexpectedly get decoded and sent to the downstream after
|
|
* promotion. See comments in ReorderBufferFinishPrepared.
|
|
*/
|
|
return false;
|
|
}
|
|
|
|
/*
|
|
* Attempt to sync LSNs and xmins only if remote slot is ahead of local
|
|
* slot.
|
|
*/
|
|
if (remote_slot->confirmed_lsn > slot->data.confirmed_flush ||
|
|
remote_slot->restart_lsn > slot->data.restart_lsn ||
|
|
TransactionIdFollows(remote_slot->catalog_xmin,
|
|
slot->data.catalog_xmin))
|
|
{
|
|
/*
|
|
* We can't directly copy the remote slot's LSN or xmin unless there
|
|
* exists a consistent snapshot at that point. Otherwise, after
|
|
* promotion, the slots may not reach a consistent point before the
|
|
* confirmed_flush_lsn which can lead to a data loss. To avoid data
|
|
* loss, we let slot machinery advance the slot which ensures that
|
|
* snapbuilder/slot statuses are updated properly.
|
|
*/
|
|
if (SnapBuildSnapshotExists(remote_slot->restart_lsn))
|
|
{
|
|
/*
|
|
* Update the slot info directly if there is a serialized snapshot
|
|
* at the restart_lsn, as the slot can quickly reach consistency
|
|
* at restart_lsn by restoring the snapshot.
|
|
*/
|
|
SpinLockAcquire(&slot->mutex);
|
|
slot->data.restart_lsn = remote_slot->restart_lsn;
|
|
slot->data.confirmed_flush = remote_slot->confirmed_lsn;
|
|
slot->data.catalog_xmin = remote_slot->catalog_xmin;
|
|
SpinLockRelease(&slot->mutex);
|
|
|
|
if (found_consistent_snapshot)
|
|
*found_consistent_snapshot = true;
|
|
}
|
|
else
|
|
{
|
|
LogicalSlotAdvanceAndCheckSnapState(remote_slot->confirmed_lsn,
|
|
found_consistent_snapshot);
|
|
|
|
/* Sanity check */
|
|
if (slot->data.confirmed_flush != remote_slot->confirmed_lsn)
|
|
ereport(ERROR,
|
|
errmsg_internal("synchronized confirmed_flush for slot \"%s\" differs from remote slot",
|
|
remote_slot->name),
|
|
errdetail_internal("Remote slot has LSN %X/%08X but local slot has LSN %X/%08X.",
|
|
LSN_FORMAT_ARGS(remote_slot->confirmed_lsn),
|
|
LSN_FORMAT_ARGS(slot->data.confirmed_flush)));
|
|
|
|
/*
|
|
* If we can't reach a consistent snapshot, the slot won't be
|
|
* persisted. See update_and_persist_local_synced_slot().
|
|
*/
|
|
if (found_consistent_snapshot && !(*found_consistent_snapshot))
|
|
pgstat_report_replslotsync(slot);
|
|
}
|
|
|
|
updated_xmin_or_lsn = true;
|
|
}
|
|
|
|
if (remote_dbid != slot->data.database ||
|
|
remote_slot->two_phase != slot->data.two_phase ||
|
|
remote_slot->failover != slot->data.failover ||
|
|
strcmp(remote_slot->plugin, NameStr(slot->data.plugin)) != 0 ||
|
|
remote_slot->two_phase_at != slot->data.two_phase_at)
|
|
{
|
|
NameData plugin_name;
|
|
|
|
/* Avoid expensive operations while holding a spinlock. */
|
|
namestrcpy(&plugin_name, remote_slot->plugin);
|
|
|
|
SpinLockAcquire(&slot->mutex);
|
|
slot->data.plugin = plugin_name;
|
|
slot->data.database = remote_dbid;
|
|
slot->data.two_phase = remote_slot->two_phase;
|
|
slot->data.two_phase_at = remote_slot->two_phase_at;
|
|
slot->data.failover = remote_slot->failover;
|
|
SpinLockRelease(&slot->mutex);
|
|
|
|
updated_config = true;
|
|
|
|
/*
|
|
* Ensure that there is no risk of sending prepared transactions
|
|
* unexpectedly after the promotion.
|
|
*/
|
|
Assert(slot->data.two_phase_at <= slot->data.confirmed_flush);
|
|
}
|
|
|
|
/*
|
|
* We have to write the changed xmin to disk *before* we change the
|
|
* in-memory value, otherwise after a crash we wouldn't know that some
|
|
* catalog tuples might have been removed already.
|
|
*/
|
|
if (updated_config || updated_xmin_or_lsn)
|
|
{
|
|
ReplicationSlotMarkDirty();
|
|
ReplicationSlotSave();
|
|
}
|
|
|
|
/*
|
|
* Now the new xmin is safely on disk, we can let the global value
|
|
* advance. We do not take ProcArrayLock or similar since we only advance
|
|
* xmin here and there's not much harm done by a concurrent computation
|
|
* missing that.
|
|
*/
|
|
if (updated_xmin_or_lsn)
|
|
{
|
|
SpinLockAcquire(&slot->mutex);
|
|
slot->effective_catalog_xmin = remote_slot->catalog_xmin;
|
|
SpinLockRelease(&slot->mutex);
|
|
|
|
ReplicationSlotsComputeRequiredXmin(false);
|
|
ReplicationSlotsComputeRequiredLSN();
|
|
}
|
|
|
|
return updated_config || updated_xmin_or_lsn;
|
|
}
|
|
|
|
/*
|
|
* Get the list of local logical slots that are synchronized from the
|
|
* primary server.
|
|
*/
|
|
static List *
|
|
get_local_synced_slots(void)
|
|
{
|
|
List *local_slots = NIL;
|
|
|
|
LWLockAcquire(ReplicationSlotControlLock, LW_SHARED);
|
|
|
|
for (int i = 0; i < max_replication_slots; i++)
|
|
{
|
|
ReplicationSlot *s = &ReplicationSlotCtl->replication_slots[i];
|
|
|
|
/* Check if it is a synchronized slot */
|
|
if (s->in_use && s->data.synced)
|
|
{
|
|
Assert(SlotIsLogical(s));
|
|
local_slots = lappend(local_slots, s);
|
|
}
|
|
}
|
|
|
|
LWLockRelease(ReplicationSlotControlLock);
|
|
|
|
return local_slots;
|
|
}
|
|
|
|
/*
|
|
* Helper function to check if local_slot is required to be retained.
|
|
*
|
|
* Return false either if local_slot does not exist in the remote_slots list
|
|
* or is invalidated while the corresponding remote slot is still valid,
|
|
* otherwise true.
|
|
*/
|
|
static bool
|
|
local_sync_slot_required(ReplicationSlot *local_slot, List *remote_slots)
|
|
{
|
|
bool remote_exists = false;
|
|
bool locally_invalidated = false;
|
|
|
|
foreach_ptr(RemoteSlot, remote_slot, remote_slots)
|
|
{
|
|
if (strcmp(remote_slot->name, NameStr(local_slot->data.name)) == 0)
|
|
{
|
|
remote_exists = true;
|
|
|
|
/*
|
|
* If remote slot is not invalidated but local slot is marked as
|
|
* invalidated, then set locally_invalidated flag.
|
|
*/
|
|
SpinLockAcquire(&local_slot->mutex);
|
|
locally_invalidated =
|
|
(remote_slot->invalidated == RS_INVAL_NONE) &&
|
|
(local_slot->data.invalidated != RS_INVAL_NONE);
|
|
SpinLockRelease(&local_slot->mutex);
|
|
|
|
break;
|
|
}
|
|
}
|
|
|
|
return (remote_exists && !locally_invalidated);
|
|
}
|
|
|
|
/*
|
|
* Drop local obsolete slots.
|
|
*
|
|
* Drop the local slots that no longer need to be synced i.e. these either do
|
|
* not exist on the primary or are no longer enabled for failover.
|
|
*
|
|
* Additionally, drop any slots that are valid on the primary but got
|
|
* invalidated on the standby. This situation may occur due to the following
|
|
* reasons:
|
|
* - The 'max_slot_wal_keep_size' on the standby is insufficient to retain WAL
|
|
* records from the restart_lsn of the slot.
|
|
* - 'primary_slot_name' is temporarily reset to null and the physical slot is
|
|
* removed.
|
|
* These dropped slots will get recreated in next sync-cycle and it is okay to
|
|
* drop and recreate such slots as long as these are not consumable on the
|
|
* standby (which is the case currently).
|
|
*
|
|
* Note: Change of 'wal_level' on the primary server to a level lower than
|
|
* logical may also result in slot invalidation and removal on the standby.
|
|
* This is because such 'wal_level' change is only possible if the logical
|
|
* slots are removed on the primary server, so it's expected to see the
|
|
* slots being invalidated and removed on the standby too (and re-created
|
|
* if they are re-created on the primary server).
|
|
*/
|
|
static void
|
|
drop_local_obsolete_slots(List *remote_slot_list)
|
|
{
|
|
List *local_slots = get_local_synced_slots();
|
|
|
|
foreach_ptr(ReplicationSlot, local_slot, local_slots)
|
|
{
|
|
/* Drop the local slot if it is not required to be retained. */
|
|
if (!local_sync_slot_required(local_slot, remote_slot_list))
|
|
{
|
|
bool synced_slot;
|
|
|
|
/*
|
|
* Use shared lock to prevent a conflict with
|
|
* ReplicationSlotsDropDBSlots(), trying to drop the same slot
|
|
* during a drop-database operation.
|
|
*/
|
|
LockSharedObject(DatabaseRelationId, local_slot->data.database,
|
|
0, AccessShareLock);
|
|
|
|
/*
|
|
* In the small window between getting the slot to drop and
|
|
* locking the database, there is a possibility of a parallel
|
|
* database drop by the startup process and the creation of a new
|
|
* slot by the user. This new user-created slot may end up using
|
|
* the same shared memory as that of 'local_slot'. Thus check if
|
|
* local_slot is still the synced one before performing actual
|
|
* drop.
|
|
*/
|
|
SpinLockAcquire(&local_slot->mutex);
|
|
synced_slot = local_slot->in_use && local_slot->data.synced;
|
|
SpinLockRelease(&local_slot->mutex);
|
|
|
|
if (synced_slot)
|
|
{
|
|
ReplicationSlotAcquire(NameStr(local_slot->data.name), true, false);
|
|
ReplicationSlotDropAcquired();
|
|
}
|
|
|
|
UnlockSharedObject(DatabaseRelationId, local_slot->data.database,
|
|
0, AccessShareLock);
|
|
|
|
ereport(LOG,
|
|
errmsg("dropped replication slot \"%s\" of database with OID %u",
|
|
NameStr(local_slot->data.name),
|
|
local_slot->data.database));
|
|
}
|
|
}
|
|
}
|
|
|
|
/*
|
|
* Reserve WAL for the currently active local slot using the specified WAL
|
|
* location (restart_lsn).
|
|
*
|
|
* If the given WAL location has been removed, reserve WAL using the oldest
|
|
* existing WAL segment.
|
|
*/
|
|
static void
|
|
reserve_wal_for_local_slot(XLogRecPtr restart_lsn)
|
|
{
|
|
XLogSegNo oldest_segno;
|
|
XLogSegNo segno;
|
|
ReplicationSlot *slot = MyReplicationSlot;
|
|
|
|
Assert(slot != NULL);
|
|
Assert(!XLogRecPtrIsValid(slot->data.restart_lsn));
|
|
|
|
while (true)
|
|
{
|
|
SpinLockAcquire(&slot->mutex);
|
|
slot->data.restart_lsn = restart_lsn;
|
|
SpinLockRelease(&slot->mutex);
|
|
|
|
/* Prevent WAL removal as fast as possible */
|
|
ReplicationSlotsComputeRequiredLSN();
|
|
|
|
XLByteToSeg(slot->data.restart_lsn, segno, wal_segment_size);
|
|
|
|
/*
|
|
* Find the oldest existing WAL segment file.
|
|
*
|
|
* Normally, we can determine it by using the last removed segment
|
|
* number. However, if no WAL segment files have been removed by a
|
|
* checkpoint since startup, we need to search for the oldest segment
|
|
* file from the current timeline existing in XLOGDIR.
|
|
*
|
|
* XXX: Currently, we are searching for the oldest segment in the
|
|
* current timeline as there is less chance of the slot's restart_lsn
|
|
* from being some prior timeline, and even if it happens, in the
|
|
* worst case, we will wait to sync till the slot's restart_lsn moved
|
|
* to the current timeline.
|
|
*/
|
|
oldest_segno = XLogGetLastRemovedSegno() + 1;
|
|
|
|
if (oldest_segno == 1)
|
|
{
|
|
TimeLineID cur_timeline;
|
|
|
|
GetWalRcvFlushRecPtr(NULL, &cur_timeline);
|
|
oldest_segno = XLogGetOldestSegno(cur_timeline);
|
|
}
|
|
|
|
elog(DEBUG1, "segno: " UINT64_FORMAT " of purposed restart_lsn for the synced slot, oldest_segno: " UINT64_FORMAT " available",
|
|
segno, oldest_segno);
|
|
|
|
/*
|
|
* If all required WAL is still there, great, otherwise retry. The
|
|
* slot should prevent further removal of WAL, unless there's a
|
|
* concurrent ReplicationSlotsComputeRequiredLSN() after we've written
|
|
* the new restart_lsn above, so normally we should never need to loop
|
|
* more than twice.
|
|
*/
|
|
if (segno >= oldest_segno)
|
|
break;
|
|
|
|
/* Retry using the location of the oldest wal segment */
|
|
XLogSegNoOffsetToRecPtr(oldest_segno, 0, wal_segment_size, restart_lsn);
|
|
}
|
|
}
|
|
|
|
/*
|
|
* If the remote restart_lsn and catalog_xmin have caught up with the
|
|
* local ones, then update the LSNs and persist the local synced slot for
|
|
* future synchronization; otherwise, do nothing.
|
|
*
|
|
* Return true if the slot is marked as RS_PERSISTENT (sync-ready), otherwise
|
|
* false.
|
|
*/
|
|
static bool
|
|
update_and_persist_local_synced_slot(RemoteSlot *remote_slot, Oid remote_dbid)
|
|
{
|
|
ReplicationSlot *slot = MyReplicationSlot;
|
|
bool found_consistent_snapshot = false;
|
|
bool remote_slot_precedes = false;
|
|
|
|
/* Slotsync skip stats are handled in function update_local_synced_slot() */
|
|
(void) update_local_synced_slot(remote_slot, remote_dbid,
|
|
&found_consistent_snapshot,
|
|
&remote_slot_precedes);
|
|
|
|
/*
|
|
* Check if the primary server has caught up. Refer to the comment atop
|
|
* the file for details on this check.
|
|
*/
|
|
if (remote_slot_precedes)
|
|
{
|
|
/*
|
|
* The remote slot didn't catch up to locally reserved position.
|
|
*
|
|
* We do not drop the slot because the restart_lsn can be ahead of the
|
|
* current location when recreating the slot in the next cycle. It may
|
|
* take more time to create such a slot. Therefore, we keep this slot
|
|
* and attempt the synchronization in the next cycle.
|
|
*/
|
|
return false;
|
|
}
|
|
|
|
/*
|
|
* Don't persist the slot if it cannot reach the consistent point from the
|
|
* restart_lsn. See comments atop this file.
|
|
*/
|
|
if (!found_consistent_snapshot)
|
|
{
|
|
ereport(LOG,
|
|
errmsg("could not synchronize replication slot \"%s\"", remote_slot->name),
|
|
errdetail("Synchronization could lead to data loss, because the standby could not build a consistent snapshot to decode WALs at LSN %X/%08X.",
|
|
LSN_FORMAT_ARGS(slot->data.restart_lsn)));
|
|
|
|
return false;
|
|
}
|
|
|
|
ReplicationSlotPersist();
|
|
|
|
ereport(LOG,
|
|
errmsg("newly created replication slot \"%s\" is sync-ready now",
|
|
remote_slot->name));
|
|
|
|
return true;
|
|
}
|
|
|
|
/*
|
|
* Synchronize a single slot to the given position.
|
|
*
|
|
* This creates a new slot if there is no existing one and updates the
|
|
* metadata of the slot as per the data received from the primary server.
|
|
*
|
|
* The slot is created as a temporary slot and stays in the same state until the
|
|
* remote_slot catches up with locally reserved position and local slot is
|
|
* updated. The slot is then persisted and is considered as sync-ready for
|
|
* periodic syncs.
|
|
*
|
|
* Returns TRUE if the local slot is updated.
|
|
*/
|
|
static bool
|
|
synchronize_one_slot(RemoteSlot *remote_slot, Oid remote_dbid)
|
|
{
|
|
ReplicationSlot *slot;
|
|
XLogRecPtr latestFlushPtr = GetStandbyFlushRecPtr(NULL);
|
|
bool slot_updated = false;
|
|
|
|
/* Search for the named slot */
|
|
if ((slot = SearchNamedReplicationSlot(remote_slot->name, true)))
|
|
{
|
|
bool synced;
|
|
|
|
SpinLockAcquire(&slot->mutex);
|
|
synced = slot->data.synced;
|
|
SpinLockRelease(&slot->mutex);
|
|
|
|
/* User-created slot with the same name exists, raise ERROR. */
|
|
if (!synced)
|
|
ereport(ERROR,
|
|
errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE),
|
|
errmsg("exiting from slot synchronization because same"
|
|
" name slot \"%s\" already exists on the standby",
|
|
remote_slot->name));
|
|
|
|
/*
|
|
* The slot has been synchronized before.
|
|
*
|
|
* It is important to acquire the slot here before checking
|
|
* invalidation. If we don't acquire the slot first, there could be a
|
|
* race condition that the local slot could be invalidated just after
|
|
* checking the 'invalidated' flag here and we could end up
|
|
* overwriting 'invalidated' flag to remote_slot's value. See
|
|
* InvalidatePossiblyObsoleteSlot() where it invalidates slot directly
|
|
* if the slot is not acquired by other processes.
|
|
*
|
|
* XXX: If it ever turns out that slot acquire/release is costly for
|
|
* cases when none of the slot properties is changed then we can do a
|
|
* pre-check to ensure that at least one of the slot properties is
|
|
* changed before acquiring the slot.
|
|
*/
|
|
ReplicationSlotAcquire(remote_slot->name, true, false);
|
|
|
|
Assert(slot == MyReplicationSlot);
|
|
|
|
/*
|
|
* Copy the invalidation cause from remote only if local slot is not
|
|
* invalidated locally, we don't want to overwrite existing one.
|
|
*/
|
|
if (slot->data.invalidated == RS_INVAL_NONE &&
|
|
remote_slot->invalidated != RS_INVAL_NONE)
|
|
{
|
|
SpinLockAcquire(&slot->mutex);
|
|
slot->data.invalidated = remote_slot->invalidated;
|
|
SpinLockRelease(&slot->mutex);
|
|
|
|
/* Make sure the invalidated state persists across server restart */
|
|
ReplicationSlotMarkDirty();
|
|
ReplicationSlotSave();
|
|
|
|
slot_updated = true;
|
|
}
|
|
|
|
/* Skip the sync of an invalidated slot */
|
|
if (slot->data.invalidated != RS_INVAL_NONE)
|
|
{
|
|
pgstat_report_replslotsync(slot);
|
|
|
|
ReplicationSlotRelease();
|
|
return slot_updated;
|
|
}
|
|
|
|
/*
|
|
* Make sure that concerned WAL is received and flushed before syncing
|
|
* slot to target lsn received from the primary server.
|
|
*
|
|
* Report statistics only after the slot has been acquired, ensuring
|
|
* it cannot be dropped during the reporting process.
|
|
*/
|
|
if (remote_slot->confirmed_lsn > latestFlushPtr)
|
|
{
|
|
pgstat_report_replslotsync(slot);
|
|
|
|
/*
|
|
* Can get here only if GUC 'synchronized_standby_slots' on the
|
|
* primary server was not configured correctly.
|
|
*/
|
|
ereport(AmLogicalSlotSyncWorkerProcess() ? LOG : ERROR,
|
|
errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE),
|
|
errmsg("skipping slot synchronization because the received slot sync"
|
|
" LSN %X/%08X for slot \"%s\" is ahead of the standby position %X/%08X",
|
|
LSN_FORMAT_ARGS(remote_slot->confirmed_lsn),
|
|
remote_slot->name,
|
|
LSN_FORMAT_ARGS(latestFlushPtr)));
|
|
|
|
return slot_updated;
|
|
}
|
|
|
|
/* Slot not ready yet, let's attempt to make it sync-ready now. */
|
|
if (slot->data.persistency == RS_TEMPORARY)
|
|
{
|
|
slot_updated = update_and_persist_local_synced_slot(remote_slot,
|
|
remote_dbid);
|
|
}
|
|
|
|
/* Slot ready for sync, so sync it. */
|
|
else
|
|
{
|
|
/*
|
|
* Sanity check: As long as the invalidations are handled
|
|
* appropriately as above, this should never happen.
|
|
*
|
|
* We don't need to check restart_lsn here. See the comments in
|
|
* update_local_synced_slot() for details.
|
|
*/
|
|
if (remote_slot->confirmed_lsn < slot->data.confirmed_flush)
|
|
ereport(ERROR,
|
|
errmsg_internal("cannot synchronize local slot \"%s\"",
|
|
remote_slot->name),
|
|
errdetail_internal("Local slot's start streaming location LSN(%X/%08X) is ahead of remote slot's LSN(%X/%08X).",
|
|
LSN_FORMAT_ARGS(slot->data.confirmed_flush),
|
|
LSN_FORMAT_ARGS(remote_slot->confirmed_lsn)));
|
|
|
|
slot_updated = update_local_synced_slot(remote_slot, remote_dbid,
|
|
NULL, NULL);
|
|
}
|
|
}
|
|
/* Otherwise create the slot first. */
|
|
else
|
|
{
|
|
NameData plugin_name;
|
|
TransactionId xmin_horizon = InvalidTransactionId;
|
|
|
|
/* Skip creating the local slot if remote_slot is invalidated already */
|
|
if (remote_slot->invalidated != RS_INVAL_NONE)
|
|
return false;
|
|
|
|
/*
|
|
* We create temporary slots instead of ephemeral slots here because
|
|
* we want the slots to survive after releasing them. This is done to
|
|
* avoid dropping and re-creating the slots in each synchronization
|
|
* cycle if the restart_lsn or catalog_xmin of the remote slot has not
|
|
* caught up.
|
|
*/
|
|
ReplicationSlotCreate(remote_slot->name, true, RS_TEMPORARY,
|
|
remote_slot->two_phase,
|
|
remote_slot->failover,
|
|
true);
|
|
|
|
/* For shorter lines. */
|
|
slot = MyReplicationSlot;
|
|
|
|
/* Avoid expensive operations while holding a spinlock. */
|
|
namestrcpy(&plugin_name, remote_slot->plugin);
|
|
|
|
SpinLockAcquire(&slot->mutex);
|
|
slot->data.database = remote_dbid;
|
|
slot->data.plugin = plugin_name;
|
|
SpinLockRelease(&slot->mutex);
|
|
|
|
reserve_wal_for_local_slot(remote_slot->restart_lsn);
|
|
|
|
LWLockAcquire(ProcArrayLock, LW_EXCLUSIVE);
|
|
xmin_horizon = GetOldestSafeDecodingTransactionId(true);
|
|
SpinLockAcquire(&slot->mutex);
|
|
slot->effective_catalog_xmin = xmin_horizon;
|
|
slot->data.catalog_xmin = xmin_horizon;
|
|
SpinLockRelease(&slot->mutex);
|
|
ReplicationSlotsComputeRequiredXmin(true);
|
|
LWLockRelease(ProcArrayLock);
|
|
|
|
/*
|
|
* Make sure that concerned WAL is received and flushed before syncing
|
|
* slot to target lsn received from the primary server.
|
|
*
|
|
* Report statistics only after the slot has been acquired, ensuring
|
|
* it cannot be dropped during the reporting process.
|
|
*/
|
|
if (remote_slot->confirmed_lsn > latestFlushPtr)
|
|
{
|
|
pgstat_report_replslotsync(slot);
|
|
|
|
/*
|
|
* Can get here only if GUC 'synchronized_standby_slots' on the
|
|
* primary server was not configured correctly.
|
|
*/
|
|
ereport(AmLogicalSlotSyncWorkerProcess() ? LOG : ERROR,
|
|
errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE),
|
|
errmsg("skipping slot synchronization because the received slot sync"
|
|
" LSN %X/%08X for slot \"%s\" is ahead of the standby position %X/%08X",
|
|
LSN_FORMAT_ARGS(remote_slot->confirmed_lsn),
|
|
remote_slot->name,
|
|
LSN_FORMAT_ARGS(latestFlushPtr)));
|
|
|
|
return false;
|
|
}
|
|
|
|
update_and_persist_local_synced_slot(remote_slot, remote_dbid);
|
|
|
|
slot_updated = true;
|
|
}
|
|
|
|
ReplicationSlotRelease();
|
|
|
|
return slot_updated;
|
|
}
|
|
|
|
/*
|
|
* Synchronize slots.
|
|
*
|
|
* Gets the failover logical slots info from the primary server and updates
|
|
* the slots locally. Creates the slots if not present on the standby.
|
|
*
|
|
* Returns TRUE if any of the slots gets updated in this sync-cycle.
|
|
*/
|
|
static bool
|
|
synchronize_slots(WalReceiverConn *wrconn)
|
|
{
|
|
#define SLOTSYNC_COLUMN_COUNT 10
|
|
Oid slotRow[SLOTSYNC_COLUMN_COUNT] = {TEXTOID, TEXTOID, LSNOID,
|
|
LSNOID, XIDOID, BOOLOID, LSNOID, BOOLOID, TEXTOID, TEXTOID};
|
|
|
|
WalRcvExecResult *res;
|
|
TupleTableSlot *tupslot;
|
|
List *remote_slot_list = NIL;
|
|
bool some_slot_updated = false;
|
|
bool started_tx = false;
|
|
const char *query = "SELECT slot_name, plugin, confirmed_flush_lsn,"
|
|
" restart_lsn, catalog_xmin, two_phase, two_phase_at, failover,"
|
|
" database, invalidation_reason"
|
|
" FROM pg_catalog.pg_replication_slots"
|
|
" WHERE failover and NOT temporary";
|
|
|
|
/* The syscache access in walrcv_exec() needs a transaction env. */
|
|
if (!IsTransactionState())
|
|
{
|
|
StartTransactionCommand();
|
|
started_tx = true;
|
|
}
|
|
|
|
/* Execute the query */
|
|
res = walrcv_exec(wrconn, query, SLOTSYNC_COLUMN_COUNT, slotRow);
|
|
if (res->status != WALRCV_OK_TUPLES)
|
|
ereport(ERROR,
|
|
errmsg("could not fetch failover logical slots info from the primary server: %s",
|
|
res->err));
|
|
|
|
/* Construct the remote_slot tuple and synchronize each slot locally */
|
|
tupslot = MakeSingleTupleTableSlot(res->tupledesc, &TTSOpsMinimalTuple);
|
|
while (tuplestore_gettupleslot(res->tuplestore, true, false, tupslot))
|
|
{
|
|
bool isnull;
|
|
RemoteSlot *remote_slot = palloc0(sizeof(RemoteSlot));
|
|
Datum d;
|
|
int col = 0;
|
|
|
|
remote_slot->name = TextDatumGetCString(slot_getattr(tupslot, ++col,
|
|
&isnull));
|
|
Assert(!isnull);
|
|
|
|
remote_slot->plugin = TextDatumGetCString(slot_getattr(tupslot, ++col,
|
|
&isnull));
|
|
Assert(!isnull);
|
|
|
|
/*
|
|
* It is possible to get null values for LSN and Xmin if slot is
|
|
* invalidated on the primary server, so handle accordingly.
|
|
*/
|
|
d = slot_getattr(tupslot, ++col, &isnull);
|
|
remote_slot->confirmed_lsn = isnull ? InvalidXLogRecPtr :
|
|
DatumGetLSN(d);
|
|
|
|
d = slot_getattr(tupslot, ++col, &isnull);
|
|
remote_slot->restart_lsn = isnull ? InvalidXLogRecPtr : DatumGetLSN(d);
|
|
|
|
d = slot_getattr(tupslot, ++col, &isnull);
|
|
remote_slot->catalog_xmin = isnull ? InvalidTransactionId :
|
|
DatumGetTransactionId(d);
|
|
|
|
remote_slot->two_phase = DatumGetBool(slot_getattr(tupslot, ++col,
|
|
&isnull));
|
|
Assert(!isnull);
|
|
|
|
d = slot_getattr(tupslot, ++col, &isnull);
|
|
remote_slot->two_phase_at = isnull ? InvalidXLogRecPtr : DatumGetLSN(d);
|
|
|
|
remote_slot->failover = DatumGetBool(slot_getattr(tupslot, ++col,
|
|
&isnull));
|
|
Assert(!isnull);
|
|
|
|
remote_slot->database = TextDatumGetCString(slot_getattr(tupslot,
|
|
++col, &isnull));
|
|
Assert(!isnull);
|
|
|
|
d = slot_getattr(tupslot, ++col, &isnull);
|
|
remote_slot->invalidated = isnull ? RS_INVAL_NONE :
|
|
GetSlotInvalidationCause(TextDatumGetCString(d));
|
|
|
|
/* Sanity check */
|
|
Assert(col == SLOTSYNC_COLUMN_COUNT);
|
|
|
|
/*
|
|
* If restart_lsn, confirmed_lsn or catalog_xmin is invalid but the
|
|
* slot is valid, that means we have fetched the remote_slot in its
|
|
* RS_EPHEMERAL state. In such a case, don't sync it; we can always
|
|
* sync it in the next sync cycle when the remote_slot is persisted
|
|
* and has valid lsn(s) and xmin values.
|
|
*
|
|
* XXX: In future, if we plan to expose 'slot->data.persistency' in
|
|
* pg_replication_slots view, then we can avoid fetching RS_EPHEMERAL
|
|
* slots in the first place.
|
|
*/
|
|
if ((!XLogRecPtrIsValid(remote_slot->restart_lsn) ||
|
|
!XLogRecPtrIsValid(remote_slot->confirmed_lsn) ||
|
|
!TransactionIdIsValid(remote_slot->catalog_xmin)) &&
|
|
remote_slot->invalidated == RS_INVAL_NONE)
|
|
pfree(remote_slot);
|
|
else
|
|
/* Create list of remote slots */
|
|
remote_slot_list = lappend(remote_slot_list, remote_slot);
|
|
|
|
ExecClearTuple(tupslot);
|
|
}
|
|
|
|
/* Drop local slots that no longer need to be synced. */
|
|
drop_local_obsolete_slots(remote_slot_list);
|
|
|
|
/* Now sync the slots locally */
|
|
foreach_ptr(RemoteSlot, remote_slot, remote_slot_list)
|
|
{
|
|
Oid remote_dbid = get_database_oid(remote_slot->database, false);
|
|
|
|
/*
|
|
* Use shared lock to prevent a conflict with
|
|
* ReplicationSlotsDropDBSlots(), trying to drop the same slot during
|
|
* a drop-database operation.
|
|
*/
|
|
LockSharedObject(DatabaseRelationId, remote_dbid, 0, AccessShareLock);
|
|
|
|
some_slot_updated |= synchronize_one_slot(remote_slot, remote_dbid);
|
|
|
|
UnlockSharedObject(DatabaseRelationId, remote_dbid, 0, AccessShareLock);
|
|
}
|
|
|
|
/* We are done, free remote_slot_list elements */
|
|
list_free_deep(remote_slot_list);
|
|
|
|
walrcv_clear_result(res);
|
|
|
|
if (started_tx)
|
|
CommitTransactionCommand();
|
|
|
|
return some_slot_updated;
|
|
}
|
|
|
|
/*
|
|
* Checks the remote server info.
|
|
*
|
|
* We ensure that the 'primary_slot_name' exists on the remote server and the
|
|
* remote server is not a standby node.
|
|
*/
|
|
static void
|
|
validate_remote_info(WalReceiverConn *wrconn)
|
|
{
|
|
#define PRIMARY_INFO_OUTPUT_COL_COUNT 2
|
|
WalRcvExecResult *res;
|
|
Oid slotRow[PRIMARY_INFO_OUTPUT_COL_COUNT] = {BOOLOID, BOOLOID};
|
|
StringInfoData cmd;
|
|
bool isnull;
|
|
TupleTableSlot *tupslot;
|
|
bool remote_in_recovery;
|
|
bool primary_slot_valid;
|
|
bool started_tx = false;
|
|
|
|
initStringInfo(&cmd);
|
|
appendStringInfo(&cmd,
|
|
"SELECT pg_is_in_recovery(), count(*) = 1"
|
|
" FROM pg_catalog.pg_replication_slots"
|
|
" WHERE slot_type='physical' AND slot_name=%s",
|
|
quote_literal_cstr(PrimarySlotName));
|
|
|
|
/* The syscache access in walrcv_exec() needs a transaction env. */
|
|
if (!IsTransactionState())
|
|
{
|
|
StartTransactionCommand();
|
|
started_tx = true;
|
|
}
|
|
|
|
res = walrcv_exec(wrconn, cmd.data, PRIMARY_INFO_OUTPUT_COL_COUNT, slotRow);
|
|
pfree(cmd.data);
|
|
|
|
if (res->status != WALRCV_OK_TUPLES)
|
|
ereport(ERROR,
|
|
errmsg("could not fetch primary slot name \"%s\" info from the primary server: %s",
|
|
PrimarySlotName, res->err),
|
|
errhint("Check if \"primary_slot_name\" is configured correctly."));
|
|
|
|
tupslot = MakeSingleTupleTableSlot(res->tupledesc, &TTSOpsMinimalTuple);
|
|
if (!tuplestore_gettupleslot(res->tuplestore, true, false, tupslot))
|
|
elog(ERROR,
|
|
"failed to fetch tuple for the primary server slot specified by \"primary_slot_name\"");
|
|
|
|
remote_in_recovery = DatumGetBool(slot_getattr(tupslot, 1, &isnull));
|
|
Assert(!isnull);
|
|
|
|
/*
|
|
* Slot sync is currently not supported on a cascading standby. This is
|
|
* because if we allow it, the primary server needs to wait for all the
|
|
* cascading standbys, otherwise, logical subscribers can still be ahead
|
|
* of one of the cascading standbys which we plan to promote. Thus, to
|
|
* avoid this additional complexity, we restrict it for the time being.
|
|
*/
|
|
if (remote_in_recovery)
|
|
ereport(ERROR,
|
|
errcode(ERRCODE_FEATURE_NOT_SUPPORTED),
|
|
errmsg("cannot synchronize replication slots from a standby server"));
|
|
|
|
primary_slot_valid = DatumGetBool(slot_getattr(tupslot, 2, &isnull));
|
|
Assert(!isnull);
|
|
|
|
if (!primary_slot_valid)
|
|
ereport(ERROR,
|
|
errcode(ERRCODE_INVALID_PARAMETER_VALUE),
|
|
/* translator: second %s is a GUC variable name */
|
|
errmsg("replication slot \"%s\" specified by \"%s\" does not exist on primary server",
|
|
PrimarySlotName, "primary_slot_name"));
|
|
|
|
ExecClearTuple(tupslot);
|
|
walrcv_clear_result(res);
|
|
|
|
if (started_tx)
|
|
CommitTransactionCommand();
|
|
}
|
|
|
|
/*
|
|
* Checks if dbname is specified in 'primary_conninfo'.
|
|
*
|
|
* Error out if not specified otherwise return it.
|
|
*/
|
|
char *
|
|
CheckAndGetDbnameFromConninfo(void)
|
|
{
|
|
char *dbname;
|
|
|
|
/*
|
|
* The slot synchronization needs a database connection for walrcv_exec to
|
|
* work.
|
|
*/
|
|
dbname = walrcv_get_dbname_from_conninfo(PrimaryConnInfo);
|
|
if (dbname == NULL)
|
|
ereport(ERROR,
|
|
errcode(ERRCODE_INVALID_PARAMETER_VALUE),
|
|
|
|
/*
|
|
* translator: first %s is a connection option; second %s is a GUC
|
|
* variable name
|
|
*/
|
|
errmsg("replication slot synchronization requires \"%s\" to be specified in \"%s\"",
|
|
"dbname", "primary_conninfo"));
|
|
return dbname;
|
|
}
|
|
|
|
/*
|
|
* Return true if all necessary GUCs for slot synchronization are set
|
|
* appropriately, otherwise, return false.
|
|
*/
|
|
bool
|
|
ValidateSlotSyncParams(int elevel)
|
|
{
|
|
/*
|
|
* Logical slot sync/creation requires wal_level >= logical.
|
|
*/
|
|
if (wal_level < WAL_LEVEL_LOGICAL)
|
|
{
|
|
ereport(elevel,
|
|
errcode(ERRCODE_INVALID_PARAMETER_VALUE),
|
|
errmsg("replication slot synchronization requires \"wal_level\" >= \"logical\""));
|
|
return false;
|
|
}
|
|
|
|
/*
|
|
* A physical replication slot(primary_slot_name) is required on the
|
|
* primary to ensure that the rows needed by the standby are not removed
|
|
* after restarting, so that the synchronized slot on the standby will not
|
|
* be invalidated.
|
|
*/
|
|
if (PrimarySlotName == NULL || *PrimarySlotName == '\0')
|
|
{
|
|
ereport(elevel,
|
|
errcode(ERRCODE_INVALID_PARAMETER_VALUE),
|
|
/* translator: %s is a GUC variable name */
|
|
errmsg("replication slot synchronization requires \"%s\" to be set", "primary_slot_name"));
|
|
return false;
|
|
}
|
|
|
|
/*
|
|
* hot_standby_feedback must be enabled to cooperate with the physical
|
|
* replication slot, which allows informing the primary about the xmin and
|
|
* catalog_xmin values on the standby.
|
|
*/
|
|
if (!hot_standby_feedback)
|
|
{
|
|
ereport(elevel,
|
|
errcode(ERRCODE_INVALID_PARAMETER_VALUE),
|
|
/* translator: %s is a GUC variable name */
|
|
errmsg("replication slot synchronization requires \"%s\" to be enabled",
|
|
"hot_standby_feedback"));
|
|
return false;
|
|
}
|
|
|
|
/*
|
|
* The primary_conninfo is required to make connection to primary for
|
|
* getting slots information.
|
|
*/
|
|
if (PrimaryConnInfo == NULL || *PrimaryConnInfo == '\0')
|
|
{
|
|
ereport(elevel,
|
|
errcode(ERRCODE_INVALID_PARAMETER_VALUE),
|
|
/* translator: %s is a GUC variable name */
|
|
errmsg("replication slot synchronization requires \"%s\" to be set",
|
|
"primary_conninfo"));
|
|
return false;
|
|
}
|
|
|
|
return true;
|
|
}
|
|
|
|
/*
|
|
* Re-read the config file.
|
|
*
|
|
* Exit if any of the slot sync GUCs have changed. The postmaster will
|
|
* restart it.
|
|
*/
|
|
static void
|
|
slotsync_reread_config(void)
|
|
{
|
|
char *old_primary_conninfo = pstrdup(PrimaryConnInfo);
|
|
char *old_primary_slotname = pstrdup(PrimarySlotName);
|
|
bool old_sync_replication_slots = sync_replication_slots;
|
|
bool old_hot_standby_feedback = hot_standby_feedback;
|
|
bool conninfo_changed;
|
|
bool primary_slotname_changed;
|
|
|
|
Assert(sync_replication_slots);
|
|
|
|
ConfigReloadPending = false;
|
|
ProcessConfigFile(PGC_SIGHUP);
|
|
|
|
conninfo_changed = strcmp(old_primary_conninfo, PrimaryConnInfo) != 0;
|
|
primary_slotname_changed = strcmp(old_primary_slotname, PrimarySlotName) != 0;
|
|
pfree(old_primary_conninfo);
|
|
pfree(old_primary_slotname);
|
|
|
|
if (old_sync_replication_slots != sync_replication_slots)
|
|
{
|
|
ereport(LOG,
|
|
/* translator: %s is a GUC variable name */
|
|
errmsg("replication slot synchronization worker will shut down because \"%s\" is disabled", "sync_replication_slots"));
|
|
proc_exit(0);
|
|
}
|
|
|
|
if (conninfo_changed ||
|
|
primary_slotname_changed ||
|
|
(old_hot_standby_feedback != hot_standby_feedback))
|
|
{
|
|
ereport(LOG,
|
|
errmsg("replication slot synchronization worker will restart because of a parameter change"));
|
|
|
|
/*
|
|
* Reset the last-start time for this worker so that the postmaster
|
|
* can restart it without waiting for SLOTSYNC_RESTART_INTERVAL_SEC.
|
|
*/
|
|
SlotSyncCtx->last_start_time = 0;
|
|
|
|
proc_exit(0);
|
|
}
|
|
|
|
}
|
|
|
|
/*
|
|
* Interrupt handler for main loop of slot sync worker.
|
|
*/
|
|
static void
|
|
ProcessSlotSyncInterrupts(void)
|
|
{
|
|
CHECK_FOR_INTERRUPTS();
|
|
|
|
if (ShutdownRequestPending)
|
|
{
|
|
ereport(LOG,
|
|
errmsg("replication slot synchronization worker is shutting down on receiving SIGINT"));
|
|
|
|
proc_exit(0);
|
|
}
|
|
|
|
if (ConfigReloadPending)
|
|
slotsync_reread_config();
|
|
}
|
|
|
|
/*
|
|
* Connection cleanup function for slotsync worker.
|
|
*
|
|
* Called on slotsync worker exit.
|
|
*/
|
|
static void
|
|
slotsync_worker_disconnect(int code, Datum arg)
|
|
{
|
|
WalReceiverConn *wrconn = (WalReceiverConn *) DatumGetPointer(arg);
|
|
|
|
walrcv_disconnect(wrconn);
|
|
}
|
|
|
|
/*
|
|
* Cleanup function for slotsync worker.
|
|
*
|
|
* Called on slotsync worker exit.
|
|
*/
|
|
static void
|
|
slotsync_worker_onexit(int code, Datum arg)
|
|
{
|
|
/*
|
|
* We need to do slots cleanup here just like WalSndErrorCleanup() does.
|
|
*
|
|
* The startup process during promotion invokes ShutDownSlotSync() which
|
|
* waits for slot sync to finish and it does that by checking the
|
|
* 'syncing' flag. Thus the slot sync worker must be done with slots'
|
|
* release and cleanup to avoid any dangling temporary slots or active
|
|
* slots before it marks itself as finished syncing.
|
|
*/
|
|
|
|
/* Make sure active replication slots are released */
|
|
if (MyReplicationSlot != NULL)
|
|
ReplicationSlotRelease();
|
|
|
|
/* Also cleanup the temporary slots. */
|
|
ReplicationSlotCleanup(false);
|
|
|
|
SpinLockAcquire(&SlotSyncCtx->mutex);
|
|
|
|
SlotSyncCtx->pid = InvalidPid;
|
|
|
|
/*
|
|
* If syncing_slots is true, it indicates that the process errored out
|
|
* without resetting the flag. So, we need to clean up shared memory and
|
|
* reset the flag here.
|
|
*/
|
|
if (syncing_slots)
|
|
{
|
|
SlotSyncCtx->syncing = false;
|
|
syncing_slots = false;
|
|
}
|
|
|
|
SpinLockRelease(&SlotSyncCtx->mutex);
|
|
}
|
|
|
|
/*
|
|
* Sleep for long enough that we believe it's likely that the slots on primary
|
|
* get updated.
|
|
*
|
|
* If there is no slot activity the wait time between sync-cycles will double
|
|
* (to a maximum of 30s). If there is some slot activity the wait time between
|
|
* sync-cycles is reset to the minimum (200ms).
|
|
*/
|
|
static void
|
|
wait_for_slot_activity(bool some_slot_updated)
|
|
{
|
|
int rc;
|
|
|
|
if (!some_slot_updated)
|
|
{
|
|
/*
|
|
* No slots were updated, so double the sleep time, but not beyond the
|
|
* maximum allowable value.
|
|
*/
|
|
sleep_ms = Min(sleep_ms * 2, MAX_SLOTSYNC_WORKER_NAPTIME_MS);
|
|
}
|
|
else
|
|
{
|
|
/*
|
|
* Some slots were updated since the last sleep, so reset the sleep
|
|
* time.
|
|
*/
|
|
sleep_ms = MIN_SLOTSYNC_WORKER_NAPTIME_MS;
|
|
}
|
|
|
|
rc = WaitLatch(MyLatch,
|
|
WL_LATCH_SET | WL_TIMEOUT | WL_EXIT_ON_PM_DEATH,
|
|
sleep_ms,
|
|
WAIT_EVENT_REPLICATION_SLOTSYNC_MAIN);
|
|
|
|
if (rc & WL_LATCH_SET)
|
|
ResetLatch(MyLatch);
|
|
}
|
|
|
|
/*
|
|
* Emit an error if a promotion or a concurrent sync call is in progress.
|
|
* Otherwise, advertise that a sync is in progress.
|
|
*/
|
|
static void
|
|
check_and_set_sync_info(pid_t worker_pid)
|
|
{
|
|
SpinLockAcquire(&SlotSyncCtx->mutex);
|
|
|
|
/* The worker pid must not be already assigned in SlotSyncCtx */
|
|
Assert(worker_pid == InvalidPid || SlotSyncCtx->pid == InvalidPid);
|
|
|
|
/*
|
|
* Emit an error if startup process signaled the slot sync machinery to
|
|
* stop. See comments atop SlotSyncCtxStruct.
|
|
*/
|
|
if (SlotSyncCtx->stopSignaled)
|
|
{
|
|
SpinLockRelease(&SlotSyncCtx->mutex);
|
|
ereport(ERROR,
|
|
errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE),
|
|
errmsg("cannot synchronize replication slots when standby promotion is ongoing"));
|
|
}
|
|
|
|
if (SlotSyncCtx->syncing)
|
|
{
|
|
SpinLockRelease(&SlotSyncCtx->mutex);
|
|
ereport(ERROR,
|
|
errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE),
|
|
errmsg("cannot synchronize replication slots concurrently"));
|
|
}
|
|
|
|
SlotSyncCtx->syncing = true;
|
|
|
|
/*
|
|
* Advertise the required PID so that the startup process can kill the
|
|
* slot sync worker on promotion.
|
|
*/
|
|
SlotSyncCtx->pid = worker_pid;
|
|
|
|
SpinLockRelease(&SlotSyncCtx->mutex);
|
|
|
|
syncing_slots = true;
|
|
}
|
|
|
|
/*
|
|
* Reset syncing flag.
|
|
*/
|
|
static void
|
|
reset_syncing_flag()
|
|
{
|
|
SpinLockAcquire(&SlotSyncCtx->mutex);
|
|
SlotSyncCtx->syncing = false;
|
|
SpinLockRelease(&SlotSyncCtx->mutex);
|
|
|
|
syncing_slots = false;
|
|
}
|
|
|
|
/*
|
|
* The main loop of our worker process.
|
|
*
|
|
* It connects to the primary server, fetches logical failover slots
|
|
* information periodically in order to create and sync the slots.
|
|
*/
|
|
void
|
|
ReplSlotSyncWorkerMain(const void *startup_data, size_t startup_data_len)
|
|
{
|
|
WalReceiverConn *wrconn = NULL;
|
|
char *dbname;
|
|
char *err;
|
|
sigjmp_buf local_sigjmp_buf;
|
|
StringInfoData app_name;
|
|
|
|
Assert(startup_data_len == 0);
|
|
|
|
MyBackendType = B_SLOTSYNC_WORKER;
|
|
|
|
init_ps_display(NULL);
|
|
|
|
Assert(GetProcessingMode() == InitProcessing);
|
|
|
|
/*
|
|
* Create a per-backend PGPROC struct in shared memory. We must do this
|
|
* before we access any shared memory.
|
|
*/
|
|
InitProcess();
|
|
|
|
/*
|
|
* Early initialization.
|
|
*/
|
|
BaseInit();
|
|
|
|
Assert(SlotSyncCtx != NULL);
|
|
|
|
/*
|
|
* If an exception is encountered, processing resumes here.
|
|
*
|
|
* We just need to clean up, report the error, and go away.
|
|
*
|
|
* If we do not have this handling here, then since this worker process
|
|
* operates at the bottom of the exception stack, ERRORs turn into FATALs.
|
|
* Therefore, we create our own exception handler to catch ERRORs.
|
|
*/
|
|
if (sigsetjmp(local_sigjmp_buf, 1) != 0)
|
|
{
|
|
/* since not using PG_TRY, must reset error stack by hand */
|
|
error_context_stack = NULL;
|
|
|
|
/* Prevents interrupts while cleaning up */
|
|
HOLD_INTERRUPTS();
|
|
|
|
/* Report the error to the server log */
|
|
EmitErrorReport();
|
|
|
|
/*
|
|
* We can now go away. Note that because we called InitProcess, a
|
|
* callback was registered to do ProcKill, which will clean up
|
|
* necessary state.
|
|
*/
|
|
proc_exit(0);
|
|
}
|
|
|
|
/* We can now handle ereport(ERROR) */
|
|
PG_exception_stack = &local_sigjmp_buf;
|
|
|
|
/* Setup signal handling */
|
|
pqsignal(SIGHUP, SignalHandlerForConfigReload);
|
|
pqsignal(SIGINT, SignalHandlerForShutdownRequest);
|
|
pqsignal(SIGTERM, die);
|
|
pqsignal(SIGFPE, FloatExceptionHandler);
|
|
pqsignal(SIGUSR1, procsignal_sigusr1_handler);
|
|
pqsignal(SIGUSR2, SIG_IGN);
|
|
pqsignal(SIGPIPE, SIG_IGN);
|
|
pqsignal(SIGCHLD, SIG_DFL);
|
|
|
|
check_and_set_sync_info(MyProcPid);
|
|
|
|
ereport(LOG, errmsg("slot sync worker started"));
|
|
|
|
/* Register it as soon as SlotSyncCtx->pid is initialized. */
|
|
before_shmem_exit(slotsync_worker_onexit, (Datum) 0);
|
|
|
|
/*
|
|
* Establishes SIGALRM handler and initialize timeout module. It is needed
|
|
* by InitPostgres to register different timeouts.
|
|
*/
|
|
InitializeTimeouts();
|
|
|
|
/* Load the libpq-specific functions */
|
|
load_file("libpqwalreceiver", false);
|
|
|
|
/*
|
|
* Unblock signals (they were blocked when the postmaster forked us)
|
|
*/
|
|
sigprocmask(SIG_SETMASK, &UnBlockSig, NULL);
|
|
|
|
/*
|
|
* Set always-secure search path, so malicious users can't redirect user
|
|
* code (e.g. operators).
|
|
*
|
|
* It's not strictly necessary since we won't be scanning or writing to
|
|
* any user table locally, but it's good to retain it here for added
|
|
* precaution.
|
|
*/
|
|
SetConfigOption("search_path", "", PGC_SUSET, PGC_S_OVERRIDE);
|
|
|
|
dbname = CheckAndGetDbnameFromConninfo();
|
|
|
|
/*
|
|
* Connect to the database specified by the user in primary_conninfo. We
|
|
* need a database connection for walrcv_exec to work which we use to
|
|
* fetch slot information from the remote node. See comments atop
|
|
* libpqrcv_exec.
|
|
*
|
|
* We do not specify a specific user here since the slot sync worker will
|
|
* operate as a superuser. This is safe because the slot sync worker does
|
|
* not interact with user tables, eliminating the risk of executing
|
|
* arbitrary code within triggers.
|
|
*/
|
|
InitPostgres(dbname, InvalidOid, NULL, InvalidOid, 0, NULL);
|
|
|
|
SetProcessingMode(NormalProcessing);
|
|
|
|
initStringInfo(&app_name);
|
|
if (cluster_name[0])
|
|
appendStringInfo(&app_name, "%s_%s", cluster_name, "slotsync worker");
|
|
else
|
|
appendStringInfoString(&app_name, "slotsync worker");
|
|
|
|
/*
|
|
* Establish the connection to the primary server for slot
|
|
* synchronization.
|
|
*/
|
|
wrconn = walrcv_connect(PrimaryConnInfo, false, false, false,
|
|
app_name.data, &err);
|
|
|
|
if (!wrconn)
|
|
ereport(ERROR,
|
|
errcode(ERRCODE_CONNECTION_FAILURE),
|
|
errmsg("synchronization worker \"%s\" could not connect to the primary server: %s",
|
|
app_name.data, err));
|
|
|
|
pfree(app_name.data);
|
|
|
|
/*
|
|
* Register the disconnection callback.
|
|
*
|
|
* XXX: This can be combined with previous cleanup registration of
|
|
* slotsync_worker_onexit() but that will need the connection to be made
|
|
* global and we want to avoid introducing global for this purpose.
|
|
*/
|
|
before_shmem_exit(slotsync_worker_disconnect, PointerGetDatum(wrconn));
|
|
|
|
/*
|
|
* Using the specified primary server connection, check that we are not a
|
|
* cascading standby and slot configured in 'primary_slot_name' exists on
|
|
* the primary server.
|
|
*/
|
|
validate_remote_info(wrconn);
|
|
|
|
/* Main loop to synchronize slots */
|
|
for (;;)
|
|
{
|
|
bool some_slot_updated = false;
|
|
|
|
ProcessSlotSyncInterrupts();
|
|
|
|
some_slot_updated = synchronize_slots(wrconn);
|
|
|
|
wait_for_slot_activity(some_slot_updated);
|
|
}
|
|
|
|
/*
|
|
* The slot sync worker can't get here because it will only stop when it
|
|
* receives a SIGINT from the startup process, or when there is an error.
|
|
*/
|
|
Assert(false);
|
|
}
|
|
|
|
/*
|
|
* Update the inactive_since property for synced slots.
|
|
*
|
|
* Note that this function is currently called when we shutdown the slot
|
|
* sync machinery.
|
|
*/
|
|
static void
|
|
update_synced_slots_inactive_since(void)
|
|
{
|
|
TimestampTz now = 0;
|
|
|
|
/*
|
|
* We need to update inactive_since only when we are promoting standby to
|
|
* correctly interpret the inactive_since if the standby gets promoted
|
|
* without a restart. We don't want the slots to appear inactive for a
|
|
* long time after promotion if they haven't been synchronized recently.
|
|
* Whoever acquires the slot, i.e., makes the slot active, will reset it.
|
|
*/
|
|
if (!StandbyMode)
|
|
return;
|
|
|
|
/* The slot sync worker or SQL function mustn't be running by now */
|
|
Assert((SlotSyncCtx->pid == InvalidPid) && !SlotSyncCtx->syncing);
|
|
|
|
LWLockAcquire(ReplicationSlotControlLock, LW_SHARED);
|
|
|
|
for (int i = 0; i < max_replication_slots; i++)
|
|
{
|
|
ReplicationSlot *s = &ReplicationSlotCtl->replication_slots[i];
|
|
|
|
/* Check if it is a synchronized slot */
|
|
if (s->in_use && s->data.synced)
|
|
{
|
|
Assert(SlotIsLogical(s));
|
|
|
|
/* The slot must not be acquired by any process */
|
|
Assert(s->active_pid == 0);
|
|
|
|
/* Use the same inactive_since time for all the slots. */
|
|
if (now == 0)
|
|
now = GetCurrentTimestamp();
|
|
|
|
ReplicationSlotSetInactiveSince(s, now, true);
|
|
}
|
|
}
|
|
|
|
LWLockRelease(ReplicationSlotControlLock);
|
|
}
|
|
|
|
/*
|
|
* Shut down the slot sync worker.
|
|
*
|
|
* This function sends signal to shutdown slot sync worker, if required. It
|
|
* also waits till the slot sync worker has exited or
|
|
* pg_sync_replication_slots() has finished.
|
|
*/
|
|
void
|
|
ShutDownSlotSync(void)
|
|
{
|
|
pid_t worker_pid;
|
|
|
|
SpinLockAcquire(&SlotSyncCtx->mutex);
|
|
|
|
SlotSyncCtx->stopSignaled = true;
|
|
|
|
/*
|
|
* Return if neither the slot sync worker is running nor the function
|
|
* pg_sync_replication_slots() is executing.
|
|
*/
|
|
if (!SlotSyncCtx->syncing)
|
|
{
|
|
SpinLockRelease(&SlotSyncCtx->mutex);
|
|
update_synced_slots_inactive_since();
|
|
return;
|
|
}
|
|
|
|
worker_pid = SlotSyncCtx->pid;
|
|
|
|
SpinLockRelease(&SlotSyncCtx->mutex);
|
|
|
|
if (worker_pid != InvalidPid)
|
|
kill(worker_pid, SIGINT);
|
|
|
|
/* Wait for slot sync to end */
|
|
for (;;)
|
|
{
|
|
int rc;
|
|
|
|
/* Wait a bit, we don't expect to have to wait long */
|
|
rc = WaitLatch(MyLatch,
|
|
WL_LATCH_SET | WL_TIMEOUT | WL_EXIT_ON_PM_DEATH,
|
|
10L, WAIT_EVENT_REPLICATION_SLOTSYNC_SHUTDOWN);
|
|
|
|
if (rc & WL_LATCH_SET)
|
|
{
|
|
ResetLatch(MyLatch);
|
|
CHECK_FOR_INTERRUPTS();
|
|
}
|
|
|
|
SpinLockAcquire(&SlotSyncCtx->mutex);
|
|
|
|
/* Ensure that no process is syncing the slots. */
|
|
if (!SlotSyncCtx->syncing)
|
|
break;
|
|
|
|
SpinLockRelease(&SlotSyncCtx->mutex);
|
|
}
|
|
|
|
SpinLockRelease(&SlotSyncCtx->mutex);
|
|
|
|
update_synced_slots_inactive_since();
|
|
}
|
|
|
|
/*
|
|
* SlotSyncWorkerCanRestart
|
|
*
|
|
* Return true, indicating worker is allowed to restart, if enough time has
|
|
* passed since it was last launched to reach SLOTSYNC_RESTART_INTERVAL_SEC.
|
|
* Otherwise return false.
|
|
*
|
|
* This is a safety valve to protect against continuous respawn attempts if the
|
|
* worker is dying immediately at launch. Note that since we will retry to
|
|
* launch the worker from the postmaster main loop, we will get another
|
|
* chance later.
|
|
*/
|
|
bool
|
|
SlotSyncWorkerCanRestart(void)
|
|
{
|
|
time_t curtime = time(NULL);
|
|
|
|
/*
|
|
* If first time through, or time somehow went backwards, always update
|
|
* last_start_time to match the current clock and allow worker start.
|
|
* Otherwise allow it only once enough time has elapsed.
|
|
*/
|
|
if (SlotSyncCtx->last_start_time == 0 ||
|
|
curtime < SlotSyncCtx->last_start_time ||
|
|
curtime - SlotSyncCtx->last_start_time >= SLOTSYNC_RESTART_INTERVAL_SEC)
|
|
{
|
|
SlotSyncCtx->last_start_time = curtime;
|
|
return true;
|
|
}
|
|
return false;
|
|
}
|
|
|
|
/*
|
|
* Is current process syncing replication slots?
|
|
*
|
|
* Could be either backend executing SQL function or slot sync worker.
|
|
*/
|
|
bool
|
|
IsSyncingReplicationSlots(void)
|
|
{
|
|
return syncing_slots;
|
|
}
|
|
|
|
/*
|
|
* Amount of shared memory required for slot synchronization.
|
|
*/
|
|
Size
|
|
SlotSyncShmemSize(void)
|
|
{
|
|
return sizeof(SlotSyncCtxStruct);
|
|
}
|
|
|
|
/*
|
|
* Allocate and initialize the shared memory of slot synchronization.
|
|
*/
|
|
void
|
|
SlotSyncShmemInit(void)
|
|
{
|
|
Size size = SlotSyncShmemSize();
|
|
bool found;
|
|
|
|
SlotSyncCtx = (SlotSyncCtxStruct *)
|
|
ShmemInitStruct("Slot Sync Data", size, &found);
|
|
|
|
if (!found)
|
|
{
|
|
memset(SlotSyncCtx, 0, size);
|
|
SlotSyncCtx->pid = InvalidPid;
|
|
SpinLockInit(&SlotSyncCtx->mutex);
|
|
}
|
|
}
|
|
|
|
/*
|
|
* Error cleanup callback for slot sync SQL function.
|
|
*/
|
|
static void
|
|
slotsync_failure_callback(int code, Datum arg)
|
|
{
|
|
WalReceiverConn *wrconn = (WalReceiverConn *) DatumGetPointer(arg);
|
|
|
|
/*
|
|
* We need to do slots cleanup here just like WalSndErrorCleanup() does.
|
|
*
|
|
* The startup process during promotion invokes ShutDownSlotSync() which
|
|
* waits for slot sync to finish and it does that by checking the
|
|
* 'syncing' flag. Thus the SQL function must be done with slots' release
|
|
* and cleanup to avoid any dangling temporary slots or active slots
|
|
* before it marks itself as finished syncing.
|
|
*/
|
|
|
|
/* Make sure active replication slots are released */
|
|
if (MyReplicationSlot != NULL)
|
|
ReplicationSlotRelease();
|
|
|
|
/* Also cleanup the synced temporary slots. */
|
|
ReplicationSlotCleanup(true);
|
|
|
|
/*
|
|
* The set syncing_slots indicates that the process errored out without
|
|
* resetting the flag. So, we need to clean up shared memory and reset the
|
|
* flag here.
|
|
*/
|
|
if (syncing_slots)
|
|
reset_syncing_flag();
|
|
|
|
walrcv_disconnect(wrconn);
|
|
}
|
|
|
|
/*
|
|
* Synchronize the failover enabled replication slots using the specified
|
|
* primary server connection.
|
|
*/
|
|
void
|
|
SyncReplicationSlots(WalReceiverConn *wrconn)
|
|
{
|
|
PG_ENSURE_ERROR_CLEANUP(slotsync_failure_callback, PointerGetDatum(wrconn));
|
|
{
|
|
check_and_set_sync_info(InvalidPid);
|
|
|
|
validate_remote_info(wrconn);
|
|
|
|
synchronize_slots(wrconn);
|
|
|
|
/* Cleanup the synced temporary slots */
|
|
ReplicationSlotCleanup(true);
|
|
|
|
/* We are done with sync, so reset sync flag */
|
|
reset_syncing_flag();
|
|
}
|
|
PG_END_ENSURE_ERROR_CLEANUP(slotsync_failure_callback, PointerGetDatum(wrconn));
|
|
}
|
|
|